|
|
| | NDSB-195 Basic information |
| | NDSB-195 Chemical Properties |
| Melting point | >300°C | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | white powder | | color | White to off-white | | Water Solubility | water: soluble | | Stability: | Hygroscopic | | Major Application | detection | | InChIKey | NNCRHRDBFDCWPA-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)([O-])CCC[N+](CC)(C)C |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | NDSB-195 Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | NDSB-195 is a non detergent sulfobetaine used as a mild solubilizing and stabilizing agent for halophilic malate dehydrogenase, halophilic elongation factor Tu (hTu), pig heart malate dehydrogenase, chicken egg white lysozyme and E. coli beta-galactosidase. Reduces aggregation and significantly improves protein renaturation. Zwitterionic over a wide pH range. NDSB-195 does not absorb significantly in the near-UV range. NDSB-195 can be easily removed by dialysis. | | Uses | A non detergent sulfobetaine used as a mild solubilizing and stabilizing agent for halophilic malate dehydrogenase, halophilic elongation factor Tu (hTu), pig heart malate dehydrogenase, chicken egg white lysozyme and E. coli beta-galactosidase. Reduces aggregation and significantly improves protein renaturation. Zwitterionic over a wide pH range. Does not absorb significantly in the near-UV range. Can be easily removed by dialysis.This compound is suitable for malate dehydrogenase (MDH) related research. |
| | NDSB-195 Preparation Products And Raw materials |
|