|
|
| | NDSB-256 Basic information |
| Product Name: | NDSB-256 | | Synonyms: | DIMETHYLBENZYL-(3-SULFOPROPYL)AMMONIUM, INNER SALT;DIMETHYLBENZYLAMMONIUM PROPANE SULFONATE;NDSB-256;3-(BENZYLDIMETHYLAMMONIO)PROPANESULFO-;3-(n-phenylmethyl-n,n-dimethylammonio)propanesulfonate;3-(BENZYLDIMETHYLAMMONIUM)PROPANESULFONATE;3-[BENZYL(DIMETHYL)AMMONIO]PROPANE-1-SULFONATE;3-[BENZYL(DIMETHYL)AMMONIO]PROPANE-1-SULPHONATE | | CAS: | 81239-45-4 | | MF: | C12H19NO3S | | MW: | 257.35 | | EINECS: | 999-999-2 | | Product Categories: | Sulfobetaines;Detergents | | Mol File: | 81239-45-4.mol |  |
| | NDSB-256 Chemical Properties |
| Melting point | 245-248 | | storage temp. | -20°C Freezer | | solubility | H2O: 10 mg/mL, clear, colorless | | form | White solid | | color | White to Off-White | | Water Solubility | water: 200mg/mL | | BRN | 9194882 | | Stability: | Hygroscopic | | InChI | 1S/C12H19NO3S/c1-13(2,9-6-10-17(14,15)16)11-12-7-4-3-5-8-12/h3-5,7-8H,6,9-11H2,1-2H3 | | InChIKey | MEJASPJNLSQOAG-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)([O-])CCC[N+](Cc1ccccc1)(C)C | | CAS DataBase Reference | 81239-45-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29239000 | | Storage Class | 11 - Combustible Solids |
| | NDSB-256 Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | A nondetergent sulfobetaines class member. | | Uses | A non detergent sulfobetaine used as a mild solubilizing and stabilizing agent for chicken egg white lysozyme and E. coli -galactosidase. At 1M, NDSB256 will restore 30% of the enzymatic activity of denatured egg white lysozyme; at 800mM it will restore 16% of the enzymatic activity of denatured -galactosidase. Reduces aggregation and significantly improves protein renaturation. Zwitterionic over a wide pH range. |
| | NDSB-256 Preparation Products And Raw materials |
|