|
|
| | 4'5'-Dimethyl-2'-hydroxypropiophenone Basic information |
| Product Name: | 4'5'-Dimethyl-2'-hydroxypropiophenone | | Synonyms: | JRH-01113, 1-(2-Hydroxy-4,5-dimethylphenyl)propan-1-one, 97%;1-Propanone, 1-(2-hydroxy-4,5-dimethylphenyl)-;1-(2-Hydroxy-4,5-dimethylphenyl)-1-propanone;4'5'-Dimethyl-2'-hydroxypropiophenone | | CAS: | 5384-13-4 | | MF: | C11H14O2 | | MW: | 178.23 | | EINECS: | | | Product Categories: | | | Mol File: | 5384-13-4.mol |  |
| | 4'5'-Dimethyl-2'-hydroxypropiophenone Chemical Properties |
| Melting point | 60–61°C | | form | solid | | InChI | 1S/C11H14O2/c1-4-10(12)9-5-7(2)8(3)6-11(9)13/h5-6,13H,4H2,1-3H3 | | InChIKey | JQMFVNFIGSUPBI-UHFFFAOYSA-N | | SMILES | CCC(C(C=C1C)=C(O)C=C1C)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Sens. 1 |
| | 4'5'-Dimethyl-2'-hydroxypropiophenone Usage And Synthesis |
| Preparation | Preparation by Fries rearrangement of 3,4-dimethylphenyl propionate with aluminium chloride
without solvent between 120° and 150° (quantitative yield), at 165° for 1 h (93%), at 100° for 2 h (90%), at 110° (85%) and in the presence of sodium chloride ;
in nitromethane at 20° for 7 days (89%). |
| | 4'5'-Dimethyl-2'-hydroxypropiophenone Preparation Products And Raw materials |
|