- 5-Aminoindan-1-one
-
- $2.15/ KG
-
2024-08-02
- CAS:3470-54-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
- 5-Aminoindan-1-one
-
- $5.50 / 1KG
-
2020-01-15
- CAS:3470-54-0
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 1kg-100kg
|
| | 5-Aminoindan-1-one Basic information |
| Product Name: | 5-Aminoindan-1-one | | Synonyms: | IFLAB-BB F0400-0036;5-AMINOINDAN-1-ONE;5-AMINO-1-INDANONE;5-Aminoindan-1-one, 95+%;5-amino-2,3-dihydroinden-1-one;5-aminoindanone;5-AMino-1-oxoindane;5-Amino-2,3-dihydro-1H-inden-1-one, 5-Amino-2,3-dihydro-1-oxo-1H-indene | | CAS: | 3470-54-0 | | MF: | C9H9NO | | MW: | 147.17 | | EINECS: | | | Product Categories: | Fused Ring Systems;Amines | | Mol File: | 3470-54-0.mol |  |
| | 5-Aminoindan-1-one Chemical Properties |
| Melting point | 184 °C | | Boiling point | 344.5±31.0 °C(Predicted) | | density | 1.254±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.12±0.20(Predicted) | | form | Solid | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C9H9NO/c10-7-2-3-8-6(5-7)1-4-9(8)11/h2-3,5H,1,4,10H2 | | InChIKey | HODOSJNSRPXYBH-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(N)C=C2)CC1 | | CAS DataBase Reference | 3470-54-0(CAS DataBase Reference) |
| | 5-Aminoindan-1-one Usage And Synthesis |
| | 5-Aminoindan-1-one Preparation Products And Raw materials |
|