| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide Basic information |
| Product Name: | (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide | | Synonyms: | (1S,2S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide;(1S,4S)- 2,5-DIAZABICYCLO[2.2.1]HEPTANE 2 HBR;(1S,4S)-(+)-2,5-DIAZABICYCLO[2.2.1]HEPTANE DIHYDROBROMIDE;(1S,4S)-2,5-DIAZABICYCLO[2.2.1]HEPTANE DIHYDROBROMIDE;(1S,2S)-2,5-Diazabicyclo2.2.1üheptane dihydrobromide, 98%;(1S,4S)-2,5-DIAZABICYCLO[2.2.1]HEPTANE DIHYDROBROMIDE 97+%;(1S,4S)-2,5-DIAZABICYLO[2.2.1]HEPTANE DIHYDROBROMIDE;2,5-Diazabicyclo[2.2.1]heptane, hydrobromide (1:2), (1S,4S)- | | CAS: | 132747-20-7 | | MF: | C5H12Br2N2 | | MW: | 259.97 | | EINECS: | 679-970-8 | | Product Categories: | Chiral | | Mol File: | 132747-20-7.mol | ![(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide Structure](CAS/GIF/132747-20-7.gif) |
| | (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide Chemical Properties |
| Melting point | 300 °C (dec.)(lit.) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow to Light orange | | Optical Rotation | [α]23/D +22°, c = 1 in H2O | | Sensitive | Hygroscopic | | BRN | 4258260 | | InChI | 1S/C5H10N2.2BrH/c1-4-2-6-5(1)3-7-4;;/h4-7H,1-3H2;2*1H/t4-,5-;;/m0../s1 | | InChIKey | ISYQWKOXKGJREA-RSLHMRQOSA-N | | SMILES | Br.Br.C1N[C@@H]2CN[C@H]1C2 | | CAS DataBase Reference | 132747-20-7(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29335990 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide Usage And Synthesis |
| Chemical Properties | Greypowder | | Uses | (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane Dihydrobromide acts as a reagent for the synthesis and characterization of new piperazine-type inhibitors for mitochondrial ubiquinone reductase, preparation of heterocyclic compounds as chemokine receptor inhibitors useful in treatment of CXCR4-mediated diseases. | | Uses | (1S,4S)-(+)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide can be used as:
- A starting material for the synthesis of chiral diazabicyclic ligands, applicable in the preparation of dicopper(II) complexes.
- A precursor in the preparation of diazabicyclo[2.2.1]heptane derivatives as catalysts, which are applicable in the asymmetric catalysis reactions.
- An organocatalyst in Biginelli reaction of aromatic aldehydes with ethyl acetoacetate and urea.
|
| | (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide Preparation Products And Raw materials |
|