|
|
| | VERPROSIDE Basic information |
| Product Name: | VERPROSIDE | | Synonyms: | VERPROSIDE;[(1aS)-1a,1bα,2,5aα,6,6aβ-Hexahydro-6α-[(3,4-dihydroxybenzoyl)oxy]-1a-(hydroxymethyl)oxireno[4,5]cyclopenta[1,2-c]pyran-2α-yl]β-D-glucopyranoside;β-D-Glucopyranoside, (1aS,1bS,2S,5aR,6S,6aS)-6-[(3,4-dihydroxybenzoyl)oxy]-1a,1b,2,5a,6,6a-hexahydro-1a-(hydroxymethyl)oxireno[4,5]cyclopenta[1,2-c]pyran-2-yl;Verproside >=95% (LC/MS-ELSD);VERPROSIDE USP/EP/BP | | CAS: | 50932-20-2 | | MF: | C22H26O13 | | MW: | 498.43 | | EINECS: | | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 50932-20-2.mol |  |
| | VERPROSIDE Chemical Properties |
| Boiling point | 822.9±65.0 °C(Predicted) | | density | 1.75±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 7.90±0.20(Predicted) | | form | solid | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChIKey | DBUOUVZMYWYRRI-YWEKDMGLSA-N | | SMILES | OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@H]3[C@H](OC(=O)c4ccc(O)c(O)c4)[C@@H]5O[C@]5(CO)[C@@H]23)[C@H](O)[C@@H](O)[C@@H]1O |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | VERPROSIDE Usage And Synthesis |
| Uses | Verproside has been shown to inhibit TNF-α-induced MUC5AC expression which aids in preventing oversecretion of mucus in asthma and chronic obstructive pulmonary disease patients. | | Definition | ChEBI: Verproside is a glycoside. It has a role as a metabolite. | | in vivo | Verproside (Intragastrically; 30 mg/kg; 48 hours) significantly reduces the immunoglobulin E (IgE) levels of verproside-treated mice[2]. | Animal Model: | Specific pathogen-free female BALB/c mice aged 8-10 weeks[2] | | Dosage: | 30 mg/kg | | Administration: | Intragastrically; 48 hours | | Result: | Reduced significantly the immunoglobulin E (IgE) levels.
|
| | IC 50 | NF-κB; IKK |
| | VERPROSIDE Preparation Products And Raw materials |
|