|
|
| | 2-Fluoro-4-methylaniline Basic information |
| | 2-Fluoro-4-methylaniline Chemical Properties |
| Melting point | 3 °C | | Boiling point | 70-71 °C/7 mmHg (lit.) | | density | 1.108 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.533(lit.) | | Fp | 175 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 3+-.0.10(Predicted) | | form | Liquid | | color | Clear orange to orange-brown | | Water Solubility | Not miscible in water. | | BRN | 2637578 | | InChI | InChI=1S/C7H8FN/c1-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3 | | InChIKey | ZQEXBVHABAJPHJ-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(C)C=C1F | | CAS DataBase Reference | 452-80-2(CAS DataBase Reference) |
| Hazard Codes | T,Xi | | Risk Statements | 23/24/25-36/37/38 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | RTECS | XU6650000 | | Hazard Note | Toxic/Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214300 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Fluoro-4-methylaniline Usage And Synthesis |
| Chemical Properties | clear orange to orange-brown liquid | | Uses | 2-Fluoro-4-methylaniline is used in the preparation of 6-chloro-5-fluoroindole via Leimgruber-Batcho reaction. It is also used in the preparation of an (S)-amino alcohol, 2-amino-3-(2-fluoro-4-methylphenyl)-propan-1-ol. | | Uses | 2-Fluoro-4-methylaniline was used in the preparation of 6-chloro-5-fluoroindole via Leimgruber-Batcho reaction. It was also used in the preparation of an (S)-amino alcohol, 2-amino-3-(2-fluoro-4-methylphenyl)-propan-1-ol. | | General Description | Rat liver microsomal metabolism of 2-fluoro-4-methylaniline was studied by HPLC. |
| | 2-Fluoro-4-methylaniline Preparation Products And Raw materials |
|