|
|
| | 3-Fluoro-4-nitrotoluene Basic information |
| | 3-Fluoro-4-nitrotoluene Chemical Properties |
| Melting point | 52-55 °C (lit.) | | Boiling point | 97-98 °C/3 mmHg (lit.) | | density | 1,438 g/cm3 | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | Insoluble in water | | form | powder to crystal | | color | Light orange to Yellow to Green | | BRN | 2502584 | | InChI | InChI=1S/C7H6FNO2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 | | InChIKey | WZMOWQCNPFDWPA-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=CC=C(C)C=C1F | | CAS DataBase Reference | 446-34-4(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Fluoro-4-nitrotoluene(446-34-4) | | EPA Substance Registry System | 3-Fluoro-4-nitrotoluene (446-34-4) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37-45-37-28A-24/25 | | RIDADR | UN2811 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Fluoro-4-nitrotoluene Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 3-Fluoro-4-nitrotoluene has been used in the preparation of IκB kinase (IKK) inhibitor, BMS [N1-(1,8-dimethylimidazo[1,2-a]quinolin-4-yl)-ethane-1,2-diamine]. |
| | 3-Fluoro-4-nitrotoluene Preparation Products And Raw materials |
|