|
|
| | Methyl 3-hydroxypropanoate Basic information |
| Product Name: | Methyl 3-hydroxypropanoate | | Synonyms: | 3-hydroxy-propanoicacidmethylester;HOCH2CH2C(O)OCH3;Hydracrylic acid, methyl ester;Methyl beta-hydroxypropionate;Methyl gamma-hydroxypropionate;Methyl hydracrylate;Methyl3-hydroxypropionate;METHYL 3-HYDROXYPROPANOATE | | CAS: | 6149-41-3 | | MF: | C4H8O3 | | MW: | 104.1 | | EINECS: | | | Product Categories: | ADVANCED INT. | | Mol File: | 6149-41-3.mol |  |
| | Methyl 3-hydroxypropanoate Chemical Properties |
| Melting point | 147-148 °C(Solv: benzene (71-43-2); cyclohexane (110-82-7)) | | Boiling point | 179°C (estimate) | | density | 1.1050 | | refractive index | 1.4300 | | storage temp. | 2-8°C | | solubility | Chloroform, Methanol | | form | Oil | | pka | 13.89±0.10(Predicted) | | color | Colourless | | InChI | InChI=1S/C4H8O3/c1-7-4(6)2-3-5/h5H,2-3H2,1H3 | | InChIKey | RVGLEPQPVDUSOJ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCO |
| HazardClass | IRRITANT | | HS Code | 2918199890 |
| | Methyl 3-hydroxypropanoate Usage And Synthesis |
| Uses | Methyl 3-hydroxypropanoate is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | Definition | ChEBI: 2-Methyl-3-hydroxypropanoate is a 3-hydroxy carboxylic acid. | | General Description |
Methyl 3-hydroxypropanoate is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs.
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins.
| | IC 50 | Alkyl/ether | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | Methyl 3-hydroxypropanoate Preparation Products And Raw materials |
|