|
|
| | BOC-ARG(Z)2-OH Basic information |
| Product Name: | BOC-ARG(Z)2-OH | | Synonyms: | N,N-Bis-(benzyloxycarbonyl)-N-tert-butoxycarbonyl-L-arginine;N-.ALPHA.-BOC-N-.OMEGA.-,N-.OMEGA.''-DI-CBZ-L-ARGININE;Boc-Arg(Z)2-OH >=98.0% (TLC);Nα-Boc-Nω,Nω'-bis-Z-L-arginine≥ 98% (HPLC);Boc-Arg(di-Z)-OH Novabiochem;BOC-N-OMEGA,N-OMEGA'-BIS-Z-L-ARGININE;BOC-L-DIBENZYLOXYCARBONYL ARGININE;BOC-L-ARG(Z2)-OH | | CAS: | 51219-19-3 | | MF: | C27H34N4O8 | | MW: | 542.58 | | EINECS: | | | Product Categories: | | | Mol File: | 51219-19-3.mol |  |
| | BOC-ARG(Z)2-OH Chemical Properties |
| Melting point | ~140 °C (dec.) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 3.96±0.21(Predicted) | | color | White to Off-White | | Optical Rotation | [α]20/D +2.5±0.5°, c = 1% in methanol | | BRN | 4914609 | | Major Application | peptide synthesis | | InChIKey | ZWRJPLNCTNRXPE-NRFANRHFSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CCCN\C(NC(=O)OCc1ccccc1)=N/C(=O)OCc2ccccc2)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2925 29 00 | | Storage Class | 11 - Combustible Solids |
| | BOC-ARG(Z)2-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Boc-Arg(Z)2-OH is used as a reagent in the preparation of antimalarial, antileishmanial, antimicrobial, cytotoxicity, and metHb formation activities of amino acid amides of quinolinamines | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-ARG(Z)2-OH Preparation Products And Raw materials |
|