|
|
| | 3-Amino-4-pyrazolecarboxamide hemisulfate Basic information |
| | 3-Amino-4-pyrazolecarboxamide hemisulfate Chemical Properties |
| Melting point | 224 °C (dec.)(lit.) | | density | 0.84 | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Very Slightly), Water (Slightly, Heated, Sonicated) | | form | Solid | | color | White to Pale Brown | | BRN | 3767200 | | Stability: | Hygroscopic | | InChI | InChI=1S/2C4H6N4O.H2O4S/c2*5-3-2(4(6)9)1-7-8-3;1-5(2,3)4/h2*1H,(H2,6,9)(H3,5,7,8);(H2,1,2,3,4) | | InChIKey | UMPKASYMNORSRO-UHFFFAOYSA-N | | SMILES | C1(C(=O)N)=CNN=C1N.C1(C(=O)N)=CNN=C1N.S(=O)(=O)(O)O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29331990 | | Storage Class | 11 - Combustible Solids |
| | 3-Amino-4-pyrazolecarboxamide hemisulfate Usage And Synthesis |
| Chemical Properties | white to slightly beige powder | | Uses | Allopurinol (A547300) impurity. A pyrazole derivative that has been shown to induce neoplasm immunogenicity. | | Uses | 3-Amino-4-pyrazolecarboxamide hemisulfate salt was used to prepare 3-carbamoyl derivatives. | | Uses | Reactant involved in synthesis of:
- Triazines and their phosphorus analogs
- Pyrazolo[3,4-d]pyrimidines for use as cyclin-dependent kinase 2 inhibitors
| | General Description | Pharmaceutical secondary standards for application in quality control provide pharma laboratories and manufacturers with a convenient and cost-effective alternative to the preparation of in-house working standards |
| | 3-Amino-4-pyrazolecarboxamide hemisulfate Preparation Products And Raw materials |
|