|
|
| | 4-Chloro-2-methyl-6-trifluoromethylquinoline Basic information |
| | 4-Chloro-2-methyl-6-trifluoromethylquinoline Chemical Properties |
| Boiling point | 277.2±35.0 °C(Predicted) | | density | 1.376±0.06 g/cm3(Predicted) | | pka | 3.26±0.50(Predicted) | | form | solid | | InChI | 1S/C11H7ClF3N/c1-6-4-9(12)8-5-7(11(13,14)15)2-3-10(8)16-6/h2-5H,1H3 | | InChIKey | RPZVTQFAPZXWFN-UHFFFAOYSA-N | | SMILES | Cc1cc(Cl)c2cc(ccc2n1)C(F)(F)F |
| Hazard Codes | T | | Risk Statements | 25-41 | | Safety Statements | 26-39-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |
| | 4-Chloro-2-methyl-6-trifluoromethylquinoline Usage And Synthesis |
| | 4-Chloro-2-methyl-6-trifluoromethylquinoline Preparation Products And Raw materials |
|