- Fucosterol
-
- $35.00
-
2026-07-27
- CAS:17605-67-3
- Purity: 98.00%
- Supply Ability: 10g
|
| | FUCOSTEROL Basic information |
| Product Name: | FUCOSTEROL | | Synonyms: | Stigmasta-5,24(28)-dien-3-ol, (3beta,24E)-;trans-24-Ethylidenecholesterol;FUCOSTEROL;5,24(28)E-CHOLESTADIEN-24-ETHYL-3BETA-OL;5,24[28]-STIGMASTADIEN-3BETA-OL;3BETA-HYDROXY-5,24[28]-STIGMASTADIENE;5-CHOLESTEN-24(28)-ETHYLIDENE-3-BETA-OL;24-ETHYLIDENCHOLEST-5-ENE-3BETA-OL | | CAS: | 17605-67-3 | | MF: | C29H48O | | MW: | 412.69 | | EINECS: | | | Product Categories: | | | Mol File: | 17605-67-3.mol |  |
| | FUCOSTEROL Chemical Properties |
| Melting point | 118-120°C | | alpha | D20 -38.4° (chloroform) | | Boiling point | 220-230 °C | | density | 0.98±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | pka | 15.03±0.70(Predicted) | | color | White to Off-White | | Cosmetics Ingredients Functions | HAIR CONDITIONING SKIN PROTECTING SKIN CONDITIONING - EMOLLIENT SKIN CONDITIONING ANTIOXIDANT | | InChI | 1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h7,10,19-20,23-27,30H,8-9,11-18H2,1-6H3/b21-7+ | | InChIKey | OSELKOCHBMDKEJ-QDNKTFMZNA-N | | SMILES | [C@@]12([H])CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])[C@H](C)CC/C(=C/C)/C(C)C |&1:0,6,10,12,16,18,21,23,r| | | LogP | 10.410 (est) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | FUCOSTEROL Usage And Synthesis |
| Uses | Fucosterol is a steroid for proteomics research. | | Definition | ChEBI: A 3beta-sterol consisting of stigmastan-3beta-ol with double bonds at positions 5 and 24(28). | | in vivo | Fucosterol (oral adminstratin; 30mg/kg) causes a significant decrease in serum glucose concentrations, and exhibits an inhibition of sorbitol accumulations in the lenses[2]. |
| | FUCOSTEROL Preparation Products And Raw materials |
|