|
|
| | 3,4-Difluorobenzotrifluoride Basic information |
| Product Name: | 3,4-Difluorobenzotrifluoride | | Synonyms: | ALPHA,ALPHA,ALPHA,3,4-PENTAFLUOROTOLUENE;3,4-DIFLUOROBENZOTRIFLUORIDE;3,4-Difluorobenzotrifluoride, 97+%;à,à,à,3,4-pentafluorotoluene;3,4-Difluorobenzotrifluoride 98%;1,2-DIFLUORO-4-TRIFLUOROMETHYL-BENZENE;3,4-Difluoronbenzotrifluoride;3,4-Difluorobenzotrifluoride98% | | CAS: | 32137-19-2 | | MF: | C7H3F5 | | MW: | 182.09 | | EINECS: | 608-708-7 | | Product Categories: | Benzotrifluoride Series;Trifluoromethylbenzene serise | | Mol File: | 32137-19-2.mol |  |
| | 3,4-Difluorobenzotrifluoride Chemical Properties |
| Melting point | 95-98 °C | | Boiling point | 103-104 °C | | density | 1.41 | | refractive index | 1.388-1.392 | | Fp | 103-104°C | | storage temp. | Sealed in dry,2-8°C | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | BRN | 1950149 | | InChI | InChI=1S/C7H3F5/c8-5-2-1-4(3-6(5)9)7(10,11)12/h1-3H | | InChIKey | MVCGQTYWLZSKSB-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(C(F)(F)F)C=C1F | | CAS DataBase Reference | 32137-19-2(CAS DataBase Reference) |
| | 3,4-Difluorobenzotrifluoride Usage And Synthesis |
| Chemical Properties | Clear colorless to light yellow liquid | | Uses | 3,4-Difluorobenzotrifluoride is a reactant in the preparation of arylacetonitriles. |
| | 3,4-Difluorobenzotrifluoride Preparation Products And Raw materials |
|