|
|
| | METHYL 3,4-DIFLUOROBENZOATE Basic information |
| | METHYL 3,4-DIFLUOROBENZOATE Chemical Properties |
| Melting point | 23-27 °C (lit.) | | Boiling point | 88 °C | | density | 1.268±0.06 g/cm3(Predicted) | | Fp | 184 °F | | storage temp. | Sealed in dry,Room Temperature | | form | fused solid | | color | White | | InChI | InChI=1S/C8H6F2O2/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4H,1H3 | | InChIKey | DWRVHDWKWKFSAI-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(F)C(F)=C1 | | CAS DataBase Reference | 369-25-5(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-36/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2916310090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | METHYL 3,4-DIFLUOROBENZOATE Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | Methyl 3,4-Difluorobenzoate is used in preparation of disubstituted 1,5-Naphthyridines as ALK5 inhibitors and therapeutic uses thereof. |
| | METHYL 3,4-DIFLUOROBENZOATE Preparation Products And Raw materials |
|