- Norcantharidin
-
-
2026-09-11
- CAS:5442-12-6
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 2000
- Norcantharidin
-
- $1158.00
-
2026-08-12
- CAS:5442-12-6
- Min. Order: 1Kg/Bag
- Purity: 98%
- Supply Ability: 1000KG
|
| | Norcantharidin Basic information |
| Product Name: | Norcantharidin | | Synonyms: | NORCANTHARIDIN;4,7-Epoxyisobenzofuran-1,3-dione, hexahydro-;EXO-7-OXABICYCLO[2.2.1]HEPTANE-2,3-DICARBOXYLIC ANHYDRIDE;TIMTEC-BB SBB008464;TIMTEC-BB SBB005955;3a,4,5,6,7,7a-Hexahydro-4,7-epoxyisobenzofuran-1,3-dione;Hexahydro-3,6-epoxyphthalic anhydride;3,6-Endooxyphthalic anhydride, hexahydro- | | CAS: | 5442-12-6 | | MF: | C8H8O4 | | MW: | 168.15 | | EINECS: | 637-280-4 | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;Plant extract;Norbornene Derivatives;Inhibitors;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 5442-12-6.mol |  |
| | Norcantharidin Chemical Properties |
| Melting point | 110 °C | | Boiling point | 362.5±35.0 °C(Predicted) | | density | 1.468±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, Room Temperature, Under inert atmosphere | | solubility | Chloroform (Slightly, Heated), DMSO (Slightly) | | form | solid | | color | White to Off-White | | Stability: | Hygroscopic, Moisture Sensitive | | InChI | InChI=1S/C8H8O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h3-6H,1-2H2 | | InChIKey | JAABVEXCGCXWRR-UHFFFAOYSA-N | | SMILES | C1(=O)C2C(C3OC2CC3)C(=O)O1 | | EPA Substance Registry System | 4,7-Epoxyisobenzofuran-1,3-dione, hexahydro- (5442-12-6) |
| WGK Germany | 3 | | RTECS | RN8400000 | | TSCA | TSCA listed |
| | Norcantharidin Usage And Synthesis |
| Uses | Norcantharidin is a potential antitumor agent. |
| | Norcantharidin Preparation Products And Raw materials |
|