|
|
| | D(-)-AMETHOPTERIN Basic information |
| Product Name: | D(-)-AMETHOPTERIN | | Synonyms: | d-methotrexate;n-(4-(((2,4-diamino-6-pteridinyl)methyl)methylamino)benzoyl)-d-glutamicacid;D(-)-AMETHOPTERIN;D-(-)-AMETHOPTERIN HYDRATE;D(-)-4-AMINO-N10-METHYLPTEROYLGLUTAMIC ACID;D-(-)-N-(2,4-diamino-6-pteridinyl(dimethylamino)benzoyl)glutamic acid;R-Methotrexate (5 mg) ((R)-2-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}benzamido)pentanedioic acid);R-Methotrexate | | CAS: | 51865-79-3 | | MF: | C20H22N8O5 | | MW: | 454.44 | | EINECS: | 257-482-2 | | Product Categories: | | | Mol File: | 51865-79-3.mol |  |
| | D(-)-AMETHOPTERIN Chemical Properties |
| Melting point | 195 °C | | Boiling point | 561.26°C (rough estimate) | | density | 1.4080 (rough estimate) | | refractive index | 1.6910 (estimate) | | storage temp. | -20°C | | solubility | Aqueous Base (Slightly, Heated, Sonicated), DMSO (Slightly), Methanol (Slightly) | | pka | 3.47±0.10(Predicted) | | form | Solid | | color | Dark Yellow to Very Dark Yellow | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChIKey | FPJYMUQSRFJSEW-UHFFFAOYSA-N | | SMILES | O.CN(Cc1cnc2nc(N)nc(N)c2n1)c3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O |
| Hazard Codes | T | | Risk Statements | 61-46-25-36/37/38-60-23/24/25 | | Safety Statements | 53-45-28A-36/37/39-26-22 | | RIDADR | UN 1544 6.1/PG 3 | | WGK Germany | WGK 3 | | RTECS | MA1224000 | | HS Code | 29335995 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Muta. 2 Repr. 1B Skin Irrit. 2 |
| Provider | Language |
|
ACROS
| English |
| | D(-)-AMETHOPTERIN Usage And Synthesis |
| Chemical Properties | Solid | | Uses | R-Methotrexate is an enantiomer of Methotrexate (M260675), a folic acid antagonist. Used as a antineoplastic and antirheumatic. |
| | D(-)-AMETHOPTERIN Preparation Products And Raw materials |
|