| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | (METHACRYLOXYMETHYL)METHYLDIMETHOXYSILANE Basic information |
| Product Name: | (METHACRYLOXYMETHYL)METHYLDIMETHOXYSILANE | | Synonyms: | (METHACRYLOXYMETHYL)METHYLDIMETHOXYSILANE;(Dimethoxy)(methacryloyloxymethyl)(methyl)silane;Geniosil XL 32;XL 32;(Dimethoxy(methyl)silyl)methyl methacrylate;2-Propenoic acid, 2-methyl-, (dimethoxymethylsilyl)methyl ester;[Dimethoxy(methyl)silyl]methyl Methacrylate (stabilized with BHT);Methacrylic Acid [Dimethoxy(methyl)silyl]methyl Ester | | CAS: | 121177-93-3 | | MF: | C8H16O4Si | | MW: | 204.3 | | EINECS: | | | Product Categories: | | | Mol File: | 121177-93-3.mol |  |
| | (METHACRYLOXYMETHYL)METHYLDIMETHOXYSILANE Chemical Properties |
| Melting point | <-100°C | | Boiling point | 205°C | | density | 1,019 g/cm3 | | refractive index | 1.4274 | | Fp | 88°C | | storage temp. | Inert atmosphere,2-8°C | | form | clear liquid | | Specific Gravity | 1.020 | | color | Colorless to Almost colorless | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C8H16O4Si/c1-6(2)7(9)12-5-13-8(10-3)11-4/h8H,1,5,13H2,2-4H3 | | InChIKey | SLRFSMGNUQIIOH-UHFFFAOYSA-N | | SMILES | C(OC[SiH2]C(OC)OC)(=O)C(C)=C | | EPA Substance Registry System | 2-Propenoic acid, 2-methyl-, (dimethoxymethylsilyl)methyl ester (121177-93-3) |
| Safety Statements | 23-24/25 | | TSCA | TSCA listed | | HS Code | 2931.90.9051 |
| | (METHACRYLOXYMETHYL)METHYLDIMETHOXYSILANE Usage And Synthesis |
| Chemical Properties | Colorless or light yellow liquid | | Uses | (METHACRYLOXYMETHYL)METHYLDIMETHOXYSILANE is primarily used as a coupling agent in inorganic materials or composites. It is suitable for UV-curing systems. It improves the strength of glass fibre composites and enhances the mechanical and electrical properties of many mineral-filled or reinforced composites. |
| | (METHACRYLOXYMETHYL)METHYLDIMETHOXYSILANE Preparation Products And Raw materials |
|