|
|
| | 3-Amino-3-phenylpropionic acid Basic information |
| | 3-Amino-3-phenylpropionic acid Chemical Properties |
| Melting point | 222 °C (dec.)(lit.) | | Boiling point | 293.03°C (rough estimate) | | density | 1.1603 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Solid | | pka | 3.45±0.12(Predicted) | | color | White to Almost white | | Water Solubility | SOLUBLE | | BRN | 2803286 | | Major Application | peptide synthesis | | InChI | InChI=1S/C9H11NO2/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) | | InChIKey | UJOYFRCOTPUKAK-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1)(N)CC(=O)O | | LogP | 0.211 (est) | | CAS DataBase Reference | 614-19-7(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25-37/39 | | WGK Germany | 3 | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids |
| | 3-Amino-3-phenylpropionic acid Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | DL-β-Phenylalanine is a useful synthetic intermediate. It was used in the synthesis of platelet aggregation inhibitors. It was also used as a reagent to synthesize human gonadotropin-releasing hormone receptor antagonists | | Definition | ChEBI: 3-amino-3-phenylpropanoic acid is a beta-amino acid that is beta-alanine substituted at position 3 by a phenyl group. It is a tautomer of a 3-ammonio-3-phenylpropanoate. | | Synthesis Reference(s) | Chemical and Pharmaceutical Bulletin, 27, p. 2223, 1979 DOI: 10.1248/cpb.27.2223 | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 3-Amino-3-phenylpropionic acid Preparation Products And Raw materials |
|