| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | Maleic acid-2,3-13C2 Basic information |
| | Maleic acid-2,3-13C2 Chemical Properties |
| Melting point | 137-140 °C(lit.) | | density | 1.499±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | solid | | InChI | 1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+/i1+1,2+1 | | InChIKey | VZCYOOQTPOCHFL-GXMZHNCCSA-N | | SMILES | OC(=O)\[13CH]=[13CH]\C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-28-39 | | RIDADR | UN 3261 8/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Maleic acid-2,3-13C2 Usage And Synthesis |
| | Maleic acid-2,3-13C2 Preparation Products And Raw materials |
|