- FMOC-SUBEROL
-
-
2026-07-13
- CAS:212783-75-0
- Min. Order: 1kg
- Purity: 97%
- FMOC-SUBEROL
-
-
2025-04-04
- CAS:212783-75-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- FMOC-SUBEROL
-
- $15.00
-
2021-07-13
- CAS:212783-75-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | FMOC-SUBEROL Basic information |
| Product Name: | FMOC-SUBEROL | | Synonyms: | 2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)tricyclo[9.4.0.03,?]pentadeca-1(15),3,5,7,11,13-hexaen-6-yl]oxy}acetic acid;1KG,25KG,100KG;acetic acid, 2-[[5-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-10,11-dihydro-5H-dibenz;RAMAGE LINKER FMOC-SUBEROL;5-FMOC-AMINO-10, 11-DIHYDRO-5H-DIBENZO[A,D]CYCLOHEPTENE-2-HYDROXY ACETIC ACID;2-{[(R,S)-5-(9-Fluorenylmethyloxycarbonyl-amino)-10,11-dihydro-5H-dibenzo[a,d]cycloheptene-2-yl]oxy}acetic acid;Fmoc-Suberol, (R,S)-2-{[5-(9-Fluorenylmethyloxycarbonylamino)-dibenzo[a,d]cycloheptane-2-yl]oxy}-acetic acid;FMOC-SUBEROL | | CAS: | 212783-75-0 | | MF: | C32H27NO5 | | MW: | 505.56 | | EINECS: | 606-734-3 | | Product Categories: | Linkers for Solid Phase Synthesis;Biochemics | | Mol File: | 212783-75-0.mol |  |
| | FMOC-SUBEROL Chemical Properties |
| Boiling point | 724.1±60.0 °C(Predicted) | | density | 1.36 | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.22±0.10(Predicted) | | color | White to off-white | | InChIKey | XHOBPBDZGGKEOX-UHFFFAOYSA-N | | SMILES | C(O)(=O)COC1C=C2CCC3=CC=CC=C3C(NC(OCC3C4=C(C=CC=C4)C4=C3C=CC=C4)=O)C2=CC=1 | | CAS DataBase Reference | 212783-75-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26-37/39 | | HS Code | 29062990 |
| | FMOC-SUBEROL Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Ramage Linker, Fmoc-suberol, also known as Ramage-Linker can be used for preparation of peptide amides specially as a acid-labile peptide amide linker. |
| | FMOC-SUBEROL Preparation Products And Raw materials |
|