|
|
| | GLYCEROL 1,3-DIMETHACRYLATE Basic information |
| | GLYCEROL 1,3-DIMETHACRYLATE Chemical Properties |
| Melting point | -33°C | | Boiling point | 120 °C1 mm Hg(lit.) | | density | 1.12 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.472(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | pka | 12.49±0.20(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.12 | | Cosmetics Ingredients Functions | NAIL CONDITIONING | | InChI | 1S/2C11H16O5/c1-7(2)10(13)15-5-9(12)6-16-11(14)8(3)4;1-7(2)10(13)15-6-9(5-12)16-11(14)8(3)4/h2*9,12H,1,3,5-6H2,2,4H3 | | InChIKey | YDASFTNANXDGLQ-UHFFFAOYSA-N | | SMILES | CC(=C)C(=O)OCC(O)COC(=O)C(C)=C.CC(=C)C(=O)OCC(CO)OC(=O)C(C)=C | | LogP | 1.539 (est) | | EPA Substance Registry System | Glycerol 1,3-dimethacrylate (1830-78-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 29161400 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | GLYCEROL 1,3-DIMETHACRYLATE Usage And Synthesis |
| Uses | Glycerol 1,3-Dimethacrylate is a monomer used in the preparation of polymeric materials. It is commonly used as a cross-linking agent and also as a polymerisation initiator. It is typically polymerised at temperatures between 60 and 100 °C to form polymers with a wide range of properties. |
| | GLYCEROL 1,3-DIMETHACRYLATE Preparation Products And Raw materials |
|