|
|
| | 4-Methylheptafluorotoluene Basic information |
| Product Name: | 4-Methylheptafluorotoluene | | Synonyms: | 1,2,4,5-Tetrafluoro-3-methyl-6-(trifluoromethyl)benzene;4-Methyl-2,3,5,6-tetrafluorobenzotrifluoride;alpha,alpha,alpha-2,3,5,6-heptafluoro-p-xylene;Benzene, 1,2,4,5-tetrafluoro-3-methyl-6-(trifluoromethyl)-;4-Methylheptafluorotoluene | | CAS: | 778-35-8 | | MF: | C8H3F7 | | MW: | 232.1 | | EINECS: | | | Product Categories: | | | Mol File: | 778-35-8.mol |  |
| | 4-Methylheptafluorotoluene Chemical Properties |
| Boiling point | 143-145 | | density | 1.528 | | refractive index | 1.329 | | InChI | InChI=1S/C8H3F7/c1-2-4(9)6(11)3(8(13,14)15)7(12)5(2)10/h1H3 | | InChIKey | JBZHWNXMZYBXDQ-UHFFFAOYSA-N | | SMILES | C1(F)=C(C(F)(F)F)C(F)=C(F)C(C)=C1F |
| Hazard Codes | Xi | | RIDADR | 1993 | | Hazard Note | Irritant | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 2903998090 |
| | 4-Methylheptafluorotoluene Usage And Synthesis |
| | 4-Methylheptafluorotoluene Preparation Products And Raw materials |
|