2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzyl bromide manufacturers
|
| | 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzyl bromide Basic information |
| Product Name: | 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzyl bromide | | Synonyms: | 4-(TRIFLUOROMETHYL)-2,3,5,6-TETRAFLUOROBENZYL BROMIDE;4-(TRIFLUOROMETHYL)TETRAFLUOROBENZYL BROMIDE;4-(BROMOMETHYL)-2,3,5,6-TETRAFLUORO-BENZOTRIFLUORIDE;1-(BROMOMETHYL)-2,3,5,6-TETRAFLUORO-4-(TRIFLUOROMETHYL)BENZENE;(4-BROMOMETHYL)HEPTAFLUOROTOLUENE;1-(bromomethyl)tetrafluoro-4-(trifluoromethyl)benzene;1-(Bromomethyl)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene, 4-(Trifluoromethyl)-2,3,5,6-tetrafluorobenzyl bromide;Benzene, 1-(bromomethyl)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)- | | CAS: | 76437-40-6 | | MF: | C8H2BrF7 | | MW: | 310.99 | | EINECS: | | | Product Categories: | | | Mol File: | 76437-40-6.mol |  |
| | 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzyl bromide Chemical Properties |
| Boiling point | 190.0±35.0 °C(Predicted) | | density | 1.864 g/mL at 25 °C (lit.) | | vapor pressure | 0.38 psi ( 20 °C) | | refractive index | n20/D 1.448(lit.) | | Fp | 210 °F | | form | liquid | | color | Clear | | Sensitive | Lachrymatory | | BRN | 8423469 | | InChI | InChI=1S/C8H2BrF7/c9-1-2-4(10)6(12)3(8(14,15)16)7(13)5(2)11/h1H2 | | InChIKey | WKPYRDRWTNJBQI-UHFFFAOYSA-N | | SMILES | C1(CBr)=C(F)C(F)=C(C(F)(F)F)C(F)=C1F |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 19 | | Hazard Note | Harmful/Lachrymatory | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzyl bromide Usage And Synthesis |
| Uses | 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzyl bromide (4-(trifluoromethyl)-2,3,5,6-tetrafluorobenzyl bromide, TTBB) may be employed as an alternate of pentafluorobenzyl bromide (PFBB) in electrophoric derivatization reactions prior to detection during gas chromatography-electron-capture negative ion mass spectrometry (GC-ECNI-MS). TTBB may be employed as derivatization reagent for the characterization and quantitation of DNA and hemoglobin adducts. | | General Description | 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzyl bromide (4-(trifluoromethyl)-2,3,5,6-tetrafluorobenzyl bromide) has been reported to be prepared in one step from α,α,α2,3,5,6-heptafluoro-p-xylene. |
| | 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzyl bromide Preparation Products And Raw materials |
|