|
|
| | 5-Amino-1H-imidazol-4-carbonitrile Basic information |
| | 5-Amino-1H-imidazol-4-carbonitrile Chemical Properties |
| Melting point | 131°C | | Boiling point | 557.7±35.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | DMSO, Methanol | | form | Solid | | pka | 9.79±0.10(Predicted) | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C4H4N4/c5-1-3-4(6)8-2-7-3/h2H,6H2,(H,7,8) | | InChIKey | XEPBRDBFOSKYCF-UHFFFAOYSA-N | | SMILES | C1NC(N)=C(C#N)N=1 | | CAS DataBase Reference | 5098-11-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 23/24/25-41-22-37/38 | | Safety Statements | 22-36/37/39-45-39-26 | | RIDADR | 3439 | | WGK Germany | 3 | | HS Code | 2933.29.9000 | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 5-Amino-1H-imidazol-4-carbonitrile Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid |
| | 5-Amino-1H-imidazol-4-carbonitrile Preparation Products And Raw materials |
|