- levoglucosenone
-
- $1.00
-
2020-02-17
- CAS:37112-31-5
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons
|
| | Levoglucosenone Basic information |
| Product Name: | Levoglucosenone | | Synonyms: | (1s)-8-dioxabicyclo(3.2.1)oct-2-en-4-one;1,6-ANHYDRO-3,4-DIDEOXY-ALPHA-D-GLYCERO-HEX-3-ENOPYRANOSE-2-ULOSE;6,8-DIOXA-BICYCLO[3.2.1]OCT-2-EN-4-ONE;1,6-Anhydro-3,4-dideoxy-a-D-glycero-hex-3-enopyranose-2-ulose;6,8-Dioxabicyclo3.2.1oct-2-en-4-one, (1S,5R)-;1,6-Anhydro-3,4-dideoxy-α-D-glycero-hex-3-enopyranose-2-ulose;(1S,5R)-6,8-Dioxabicyclo[3.2.1]oct-2-en-4-one;(1β,5β)-6,8-Dioxabicyclo[3.2.1]octa-2-ene-4-one | | CAS: | 37112-31-5 | | MF: | C6H6O3 | | MW: | 126.11 | | EINECS: | | | Product Categories: | Chiral Reagents;Heterocycles | | Mol File: | 37112-31-5.mol |  |
| | Levoglucosenone Chemical Properties |
| alpha | D25 -460° (c = 1.0 in CHCl3) (Halpern, 1973); D31 -514.8° (c = 0.3 in CHCl3) (Taniguchi). | | Boiling point | 113°C/3mmHg(lit.) | | density | 1.329±0.06 g/cm3(Predicted) | | refractive index | nD25 1.5084 | | storage temp. | Amber Vial, -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Sparingly), DMSO (Slightly), Ethyl Acetate (Slightly) | | form | liquid | | color | Colourless to Yellow | | Merck | 14,5465 | | Stability: | Light Sensitive | | InChI | InChI=1S/C6H6O3/c7-5-2-1-4-3-8-6(5)9-4/h1-2,4,6H,3H2/t4-,6+/m0/s1 | | InChIKey | HITOXZPZGPXYHY-UJURSFKZSA-N | | SMILES | [C@@]12([H])O[C@@]([H])(OC1)C(=O)C=C2 | | LogP | -0.740 (est) |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | RTECS | JG7020000 | | HS Code | 2932990090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | Levoglucosenone Usage And Synthesis |
| Chemical Properties | Colourless to Yellow Oil | | Uses | (-)-Form Levoglucosenone is a pyrolysis product of cellulose and cellulose-containing materials including pulp and paper waste products. Known as a pyrolytic product of cellulose, its very useful as a chiral source for synthesizing natural products. | | Uses | useful carbohydrate synthon | | Uses | Chiral building block in organic synthesis. | | Definition | ChEBI: Levoglucosenone is an anhydrohexose and a deoxyketohexose. |
| | Levoglucosenone Preparation Products And Raw materials |
|