| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Bromo-5-iodobenzonitrile Basic information |
| | 2-Bromo-5-iodobenzonitrile Chemical Properties |
| Boiling point | 324.3±32.0 °C(Predicted) | | density | 2.31 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Appearance | Light brown to yellow Solid | | InChI | InChI=1S/C7H3BrIN/c8-7-2-1-6(9)3-5(7)4-10/h1-3H | | InChIKey | KXTNUMXYGMBTSV-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(I)=CC=C1Br |
| RIDADR | 3439 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 2926907090 |
| | 2-Bromo-5-iodobenzonitrile Usage And Synthesis |
| Uses | 2-Bromo-5-iodobenzonitrile is primarily used in organic synthesis and pharmaceutical synthesis.
|
| | 2-Bromo-5-iodobenzonitrile Preparation Products And Raw materials |
|