|
|
| | 2,6-Diethyl-N-(2-propoxyethyl)aniline Basic information |
| Product Name: | 2,6-Diethyl-N-(2-propoxyethyl)aniline | | Synonyms: | 2,6-DIETHYL-N-(2-PROPOXYETHYL)ANILINE;PEDA;2,6-Diethyl-N-(2-propoxyethyl)-benzenamine;N-Propoxyethyl-2,6-Diethyl Aniline;Benzenamine, 2,6-diethyl-N-(2-propoxyethyl)- | | CAS: | 61874-13-3 | | MF: | C15H25NO | | MW: | 235.37 | | EINECS: | | | Product Categories: | | | Mol File: | 61874-13-3.mol |  |
| | 2,6-Diethyl-N-(2-propoxyethyl)aniline Chemical Properties |
| Boiling point | 352°C | | density | 0.953 | | Fp | 150°C | | pka | 4.01±0.50(Predicted) | | InChI | InChI=1S/C15H25NO/c1-4-11-17-12-10-16-15-13(5-2)8-7-9-14(15)6-3/h7-9,16H,4-6,10-12H2,1-3H3 | | InChIKey | DTEGEQGTAYAXBC-UHFFFAOYSA-N | | SMILES | C1(NCCOCCC)=C(CC)C=CC=C1CC | | CAS DataBase Reference | 61874-13-3(CAS DataBase Reference) |
| | 2,6-Diethyl-N-(2-propoxyethyl)aniline Usage And Synthesis |
| Description | 2,6-Diethyl-N-(2-propoxyethyl)aniline is an organic compound that is synthesized by the reaction of sodium hydride and 2-propoxyethanol. It has been found to be a stable herbicide with no adverse effects on the environment. |
| | 2,6-Diethyl-N-(2-propoxyethyl)aniline Preparation Products And Raw materials |
|