- Pretilachlor
-
- $10.00
-
2026-03-20
- CAS:51218-49-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100 mt
- Pretilachlor
-
-
2025-12-24
- CAS:51218-49-6
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000KG
- Pretilachlor
-
- $30.00
-
2025-05-26
- CAS:51218-49-6
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 100 tons
|
| | Pretilachlor Basic information |
| Product Name: | Pretilachlor | | Synonyms: | 2-Chloro-N-(2,6-diethylphenyl)-N-(2-propoxyethyl)acetamide;2-CHLORO-2',6'-DIETHYL-N-(2-PROPOXYETHYL)ACETANILIDE;RIFIT;SOFIT;SOLNET;PRETILACHLOR;Pretilchlor;2-chloro-n-(2,6-diethylphenyl)-n-(2-propoxyethyl)-acetamid | | CAS: | 51218-49-6 | | MF: | C17H26ClNO2 | | MW: | 311.85 | | EINECS: | | | Product Categories: | Agro-Chemicals;HERBICIDE | | Mol File: | 51218-49-6.mol |  |
| | Pretilachlor Chemical Properties |
| Melting point | 25°C | | Boiling point | bp0.001 135° | | density | 1.0521 (rough estimate) | | refractive index | nD20 1.5204 | | storage temp. | Inert atmosphere,2-8°C | | Water Solubility | Insoluble in water | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid
(Density: 1.074±0.06 g/cm3) | | pka | 1.41±0.50(Predicted) | | Specific Gravity | 1.076 (20℃) | | color | Light yellow to Brown | | Merck | 14,7740 | | BRN | 2754162 | | Henry's Law Constant | 4.5×103 mol/(m3Pa) at 25℃, Hilal et al. (2008) | | Major Application | agriculture
environmental | | InChI | 1S/C17H26ClNO2/c1-4-11-21-12-10-19(16(20)13-18)17-14(5-2)8-7-9-15(17)6-3/h7-9H,4-6,10-13H2,1-3H3 | | InChIKey | YLPGTOIOYRQOHV-UHFFFAOYSA-N | | SMILES | CCCOCCN(C(=O)CCl)c1c(CC)cccc1CC | | CAS DataBase Reference | 51218-49-6(CAS DataBase Reference) | | NIST Chemistry Reference | Pretilachlor(51218-49-6) |
| Hazard Codes | Xi;N,N,Xi | | Risk Statements | 38-50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 2 | | RTECS | AB5427000 | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29242990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Inhalation
Skin Irrit. 2 | | Toxicity | LD50 in rats (mg/kg): 6099 orally; >3100 dermally (Rufener, Quadranti); LC50 in rainbow trout, carp, catfish: 3.0, 3.0, 2.6 ppm (Vogel, Aebi) |
| | Pretilachlor Usage And Synthesis |
| Chemical Properties | Pale Yellow Oil | | Uses | Pretilachlor is a chloroacetanalide herbicide. Pretilachlor is commonly used for weed control in wet seeded rice | | Uses | Herbicide for use in rice paddys. | | Definition | ChEBI: Pretilachlor is an anilide. | | Production Methods | The industrial synthesis of pretilachlor begins with the formation of 3-propoxypropionaldehyde, which is prepared by reacting sodium n-propoxide with 2-chloroacetaldehyde dimethyl acetal. This intermediate is then subjected to reductive amination with 2,6-diethylaniline in the presence of a hydrogenation catalyst under controlled pressure and temperature to yield the corresponding aminoether. The final step involves acylation of the aminoether with chloroacetyl chloride in a biphasic system using sodium hydroxide and toluene, forming the active pretilachlor compound. These reactions are carefully managed to ensure high yield and purity, with purification typically achieved through crystallisation or solvent extraction. | | Mechanism of action | Selective. Inhibition of very long chain fatty acids (VLCFA, inhibition of cell division) | | Pesticide Type | Herbicide |
| | Pretilachlor Preparation Products And Raw materials |
|