| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
5-Bromo-1,3-benzodioxole-4-carboxylic acid manufacturers
|
| | 5-Bromo-1,3-benzodioxole-4-carboxylic acid Basic information | | Application |
| | 5-Bromo-1,3-benzodioxole-4-carboxylic acid Chemical Properties |
| Melting point | 169-173 °C | | Boiling point | 353.2±42.0 °C(Predicted) | | density | 1.894±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 2.62±0.20(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C8H5BrO4/c9-4-1-2-5-7(13-3-12-5)6(4)8(10)11/h1-2H,3H2,(H,10,11) | | InChIKey | HDNXEXSQANVCKC-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(Br)C(C(O)=O)=C2OC1 |
| | 5-Bromo-1,3-benzodioxole-4-carboxylic acid Usage And Synthesis |
| Application | 5-Bromobenzo[1,3]dioxacyclopentene-4-carboxylic acid is a carboxylic acid derivative that can be used as a pharmaceutical synthesis intermediate. | | Synthesis | 5-Bromobenzo[1,3]dioxole-4-carboxylic acid can be prepared from 6-bromo-2,3-dihydroxybenzaldehyde in three steps.
|
| | 5-Bromo-1,3-benzodioxole-4-carboxylic acid Preparation Products And Raw materials |
|