|
|
| | 2-BROMO-5-METHOXYBENZOIC ACID Basic information | | Uses |
| | 2-BROMO-5-METHOXYBENZOIC ACID Chemical Properties |
| Melting point | 157-159 °C (lit.) | | Boiling point | 337.8±27.0 °C(Predicted) | | density | 1.625±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, DMSO, Methanol | | form | Solid | | pka | 2.73±0.10(Predicted) | | color | White to Off-White | | BRN | 639763 | | InChI | InChI=1S/C8H7BrO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11) | | InChIKey | ODHJOROUCITYNF-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(OC)=CC=C1Br | | CAS DataBase Reference | 22921-68-2(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids |
| | 2-BROMO-5-METHOXYBENZOIC ACID Usage And Synthesis |
| Uses | 2-Bromo-5-methoxybenzoic Acid, is an intermediate in the synthesis of more complex pharmaceutical and biologically active compounds. It is used in the synthesis of benzylisothioureas as potent divalent metal transporter 1 (DMT1) inhibitors. | | Chemical Properties | white to light yellow crystal powder | | Uses | 2-Bromo-5-methoxybenzoic acid is suitable for use in the syntheses of urolithin derivatives. It may be used in the synthesis of the following:
- substituted aminobenzacridines
- 8-chloro-2-methoxydibenzo[b,f]thiepin-10(11H)-one and its 3-methoxy derivative
- isoindolinone derivatives
| | General Description | 2-Bromo-5-methoxybenzoic acid is a benzoic acid derivative. Synthesis of 2-bromo-5-methoxybenzoic acid and its characterization by HNMR has been reported. |
| | 2-BROMO-5-METHOXYBENZOIC ACID Preparation Products And Raw materials |
|