| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1H,1H,2H,2H-Perfluoro-1-decanol Basic information |
| Product Name: | 1H,1H,2H,2H-Perfluoro-1-decanol | | Synonyms: | Perfluoroalkyl ethanol 1H,1H,2H,2H-PERFLUORODECAN-1-OL;Heptadecafluoro-N-decanol;1H,1H,2H,2H-Perfluorodecan-1-ol 97%;1H,1H,2H,2H-Perfluorodecan-1-ol97%;HEPTADECAFLUORODECANE-1-OL;8-2FLUOROTELOMERALCOHOL;3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluordecan-1-ol;perfluorooctyl ethanol | | CAS: | 678-39-7 | | MF: | C10H5F17O | | MW: | 464.12 | | EINECS: | 211-648-0 | | Product Categories: | organofluorine compounds;Organics;Organic Fluorides;Fluorous Chemistry;Fluorous Compounds;Synthetic Organic Chemistry | | Mol File: | 678-39-7.mol |  |
| | 1H,1H,2H,2H-Perfluoro-1-decanol Chemical Properties |
| Melting point | 50 °C | | Boiling point | 113°C 10mm | | density | 1.633±0.06 g/cm3(Predicted) | | Fp | None | | storage temp. | 2-8°C | | solubility | Soluble in chloroform and methanol. | | form | solid | | pka | 14.28±0.10(Predicted) | | color | tan | | BRN | 2227487 | | Henry's Law Constant | 2.0×10-4 mol/(m3Pa) at 25℃, Abusallout et al. (2022) | | Major Application | PFAS testing | | InChI | InChI=1S/C10H5F17O/c11-3(12,1-2-28)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h28H,1-2H2 | | InChIKey | JJUBFBTUBACDHW-UHFFFAOYSA-N | | SMILES | C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 678-39-7(CAS DataBase Reference) | | EPA Substance Registry System | 1-Decanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro- (678-39-7) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 1 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29055900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Dam. 1
Lact.
Repr. 1B
STOT RE 1 |
| | 1H,1H,2H,2H-Perfluoro-1-decanol Usage And Synthesis |
| Chemical Properties | White to light yellow solid | | Uses | 1,1,2,2-Tetrahydroperfluorodecanol is applied to the formation of a barrier and self-healing coating on zinc metal materials. This compound has also been seen to induce cell death and formation of oxidative or reactive oxygen species in cerebellar granule cells. | | Uses | 1H,1H,2H,2H-Perfluoro-1-decanol (8:2 FTOH) may be used in the preparation of 8:2 FTOH sulfate and 8:2 FTOH glucuronide. | | Definition | ChEBI: A fluorotelomer alcohol that is ethanol substituted at position 2 by a perfluorooctyl group. | | General Description | 1H,1H,2H,2H-Perfluoro-1-decanol (8:2 FTOH) is an 8:2 fluorotelomer alcohol. The quantitative analysis of 8:2 FTOH in soil can be done using GC/MS with instrument detection limit (IDL) of 10fg/L. Studies indicate that hydroxyl radical causes indirect photodegradation of 8:2 FTOH in aqueous media. |
| | 1H,1H,2H,2H-Perfluoro-1-decanol Preparation Products And Raw materials |
|