| Company Name: |
Shangfluoro Gold |
| Tel: |
021-65170832 15601903708 |
| Email: |
qinba_2@163.com |
|
| | 2-(Perfluorohexyl)ethyl methacrylate Basic information |
| Product Name: | 2-(Perfluorohexyl)ethyl methacrylate | | Synonyms: | 1H,1H,2H,2H-Tridecafluorooct-1-yl methacrylate 99%;2-(Perfluorohex-1-yl)ethyl methacrylate, 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooct-1-yl 2-methylprop-2-enoate;1H,1H,2H,2H-Tridecafluoro-n-octyl Methacrylate (stabilized with MEHQ);1H,1H,2H,2H-Tridecafluoro-n-octyl Methacrylate (stabilized with HQ + MEHQ);3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl methacrylate contains 100 ppm 4-tert-butylcatechol as inhibitor, 97%;2-propenoicacid,2-methyl-,3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylester;2-(PERFLUOROHEXYL)ETHYL METHACRYLATE;3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTYL METHACRYLATE | | CAS: | 2144-53-8 | | MF: | C12H9F13O2 | | MW: | 432.18 | | EINECS: | 218-407-9 | | Product Categories: | monomer;Acrylic Monomers;Fluorinated Acrylics;Monomers | | Mol File: | 2144-53-8.mol |  |
| | 2-(Perfluorohexyl)ethyl methacrylate Chemical Properties |
| Boiling point | 92 °C8 mm Hg(lit.) | | density | 1.496 g/mL at 25 °C(lit.) | | vapor pressure | 8.6Pa at 25℃ | | refractive index | n20/D 1.346(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Soluble), Methanol (Sparingly) | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.496 | | Water Solubility | 42μg/L at 20℃ | | Henry's Law Constant | 1.2×10-6 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | Major Application | PFAS testing | | InChI | InChI=1S/C12H9F13O2/c1-5(2)6(26)27-4-3-7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h1,3-4H2,2H3 | | InChIKey | CDXFIRXEAJABAZ-UHFFFAOYSA-N | | SMILES | C(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(=O)C(C)=C | | LogP | 5.2 at 23℃ | | CAS DataBase Reference | 2144-53-8(CAS DataBase Reference) | | EPA Substance Registry System | 2-Propenoic acid, 2-methyl-, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl ester (2144-53-8) |
| Hazard Codes | Xi,F | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | UD3580000 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29161290 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-(Perfluorohexyl)ethyl methacrylate Usage And Synthesis |
| Uses | Surface structure and outer group orientation in poly(perfluoroalkylethyl methacrylate) consist of Tridecafluorohexylethyl Methacrylate.Semifluorinated diblock copolymers based on Me methacrylate and Tridecafluorohexylethyl Methacrylate were prepared by nucleophilic catalyzed group transfer polymerization. | | Flammability and Explosibility | Non flammable |
| | 2-(Perfluorohexyl)ethyl methacrylate Preparation Products And Raw materials |
|