| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1H,1H-Perfluoro-1-decanol Basic information |
| Product Name: | 1H,1H-Perfluoro-1-decanol | | Synonyms: | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-NONADECAFLUORO-1-DECANOL;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-NONADECFLUORO-1-DECANOL;1H,1H-Perfluorodecan-1-ol 98%;1H,1H-Perfluorodecan-1-ol98%;1H,1H-Nonadecafluoro-1-decanol;1H,1H-PERFLUORO-1-DECANOL 98%;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Nonadecafluoro-1-decanol,98%;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Nonadecafluorodecan-1-ol, (Perfluoronon-1-yl)methanol | | CAS: | 307-37-9 | | MF: | C10H3F19O | | MW: | 500.1 | | EINECS: | 670-432-8 | | Product Categories: | Alcohols;C9 to C30;Oxygen Compounds | | Mol File: | 307-37-9.mol |  |
| | 1H,1H-Perfluoro-1-decanol Chemical Properties |
| Melting point | 87-90 °C(lit.) | | Boiling point | 192 °C735 mm Hg(lit.) | | density | 1.6820 (estimate) | | Fp | 95°C/20mm | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 12.88±0.10(Predicted) | | form | Solid | | color | Off-White | | BRN | 1810012 | | InChI | 1S/C10H3F19O/c11-2(12,1-30)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h30H,1H2 | | InChIKey | NIRPXSQCRWXHNZ-UHFFFAOYSA-N | | SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 307-37-9(CAS DataBase Reference) | | EPA Substance Registry System | 9:1 Fluorotelomer alcohol (307-37-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29081990 | | Storage Class | 11 - Combustible Solids |
| | 1H,1H-Perfluoro-1-decanol Usage And Synthesis |
| Chemical Properties | white powder | | Uses | 1H,1H-Perfluoro-1-decanol can be introduced into esterifying moiety of bacteriochlorophyll c in green sulfur photosynthetic bacterium Chlorobaculum tepidum by pigment biosynthesis. | | General Description | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Nonadecafluoro-1-decanol is a fluorotelomer alcohol (FTOH). |
| | 1H,1H-Perfluoro-1-decanol Preparation Products And Raw materials |
|