| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Chloro-2-(trifluoroacetyl)aniline hydrochloride Basic information |
| Product Name: | 4-Chloro-2-(trifluoroacetyl)aniline hydrochloride | | Synonyms: | 4-CHLORO-2(1,1-DIHYDROXY-2,2,2-TRIFLUOROETHYL)ANILINE HCL;4-CHLORO-2,2,2-TRIFLUORO ACETYL ANILINE HYDROCHLORIDE;1-(2-aMino-5-chlorophenyl)-2,2,2-trifluoroethanone hydrochloride;Ethanone,1-(2-aMino-5-chlorophenyl)-2,2,2-trifluoro-, hydrochloride (1:1);Efavirenz Intermediate E-2;E2，173676-59-0;1-(2-Amino-5-chlorophenyl)-2,2,2-trifluoroethan-1-one hydrate hydrochloride;Efavirenz Intermediate: Trifluoroethanone | | CAS: | 173676-59-0 | | MF: | C8H6Cl2F3NO | | MW: | 260.04 | | EINECS: | 605-687-6 | | Product Categories: | Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;Amines and Anilines;Carbonyl Compounds;Aromatics Compounds | | Mol File: | 173676-59-0.mol |  |
| | 4-Chloro-2-(trifluoroacetyl)aniline hydrochloride Chemical Properties |
| Melting point | 156-158°C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | Pale Yellow | | InChI | InChI=1S/C8H5ClF3NO.ClH/c9-4-1-2-6(13)5(3-4)7(14)8(10,11)12;/h1-3H,13H2;1H | | InChIKey | PNLSPSLPBVQWAB-UHFFFAOYSA-N | | SMILES | C(C1C=C(Cl)C=CC=1N)(=O)C(F)(F)F.Cl |
| Hazard Codes | Xi | | HS Code | 2921420090 |
| | 4-Chloro-2-(trifluoroacetyl)aniline hydrochloride Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | HIV reverse transcriptase inhibitor. | | Synthesis | Step 2: Synthesis of 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone hydrochloride from 4-chloro-2-bromophenylneopentanamide. A small amount of iodine pellets was added to a mixture containing magnesium shavings (1 equiv.) and 2 volumes of tetrahydrofuran (THF) to initiate the reaction at room temperature. Subsequently, the starting material (4-chloro-2-bromophenyl) pivalamide (1 g) was added and waited for the reaction to initiate. After the reaction started, the feedstock dissolved in 1 volume of THF was added dropwise. After dropwise addition, lithium chloride (0.25 mmol) was added to the reaction mixture and stirred at room temperature for about 6 hours. The reaction mixture was cooled to -15 °C and ethyl trifluoroacetate (1.4 mmol) was added. The temperature of the reaction mixture was raised to 20 °C and kept for about 30 min, after which the reaction was quenched with ammonium chloride solution. The reaction mixture was extracted with methyl tert-butyl ether (MTBE), the organic layers were combined and concentrated under reduced pressure. Acetic acid (4 vol) and hydrochloric acid (2 vol) were added to the resulting crude product. The reaction mixture was slowly heated to 75 °C and kept at this temperature for about 4 hours. Upon completion of the reaction, the mixture was cooled to 0-5 °C and kept for 2 h. The mixture was filtered and washed with 1 volume of ethyl acetate to give 4-chloro-2-(trifluoroacetyl)aniline hydrochloride in 70% yield. | | References | [1] Patent: WO2015/118515, 2015, A1. Location in patent: Page/Page column 15 |
| | 4-Chloro-2-(trifluoroacetyl)aniline hydrochloride Preparation Products And Raw materials |
|