Bis(3,5-difluorophenyl)sulfoxide manufacturers
|
| | Bis(3,5-difluorophenyl)sulfoxide Basic information |
| Product Name: | Bis(3,5-difluorophenyl)sulfoxide | | Synonyms: | 1,1′-Sulfinylbis[3,5-difluorobenzene;Bis(3,5-difluorophenyl)sulfoxide;Benzene, 1,1'-sulfinylbis[3,5-difluoro-;5,5'-Sulfinylbis(1,3-difluorobenzene);1,1'-Sulfinylbis[3,5-difluorobenzene | | CAS: | 2055858-27-8 | | MF: | C12H6F4OS | | MW: | 274.23 | | EINECS: | | | Product Categories: | | | Mol File: | 2055858-27-8.mol |  |
| | Bis(3,5-difluorophenyl)sulfoxide Chemical Properties |
| Boiling point | 360.6±42.0 °C(Predicted) | | density | 1.52±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C12H6F4OS/c13-7-1-8(14)4-11(3-7)18(17)12-5-9(15)2-10(16)6-12/h1-6H | | InChIKey | VTZWUMHFBYQZRF-UHFFFAOYSA-N | | SMILES | S(C1=CC(F)=CC(F)=C1)(C1=CC(F)=CC(F)=C1)=O |
| | Bis(3,5-difluorophenyl)sulfoxide Usage And Synthesis |
| Uses | 1,1'-Sulfinylbis[3,5-difluorobenzene], also known as Bis(3,5-difluorophenyl)sulfoxide, is an organofluorinated reagent that can be used in the formation of positive photoresist compositions and patterns. |
| | Bis(3,5-difluorophenyl)sulfoxide Preparation Products And Raw materials |
|