| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Tributylmethylammonium methyl carbonate Basic information |
| Product Name: | Tributylmethylammonium methyl carbonate | | Synonyms: | Tributylmethylammonium methyl carbonate;Methyltributylammonium methyl carbonate;Tributylmethylammonium methyl carbonate solution;Tributylmethylammonium methyl carbonate solution ~50% in methanol: water (2:3);methyl carbonate,tributyl(methyl)azanium;n,n-Dibutyl-n-methylbutan-1-aminium methyl carbonate | | CAS: | 274257-37-3 | | MF: | C15H33NO3 | | MW: | 275.42742 | | EINECS: | | | Product Categories: | | | Mol File: | 274257-37-3.mol |  |
| | Tributylmethylammonium methyl carbonate Chemical Properties |
| refractive index | n20/D 1.408 | | Fp | 57 °C | | InChI | 1S/C13H30N.C2H4O3/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-5-2(3)4/h5-13H2,1-4H3;1H3,(H,3,4)/q+1;/p-1 | | InChIKey | ZKWSMHMGQLTZGI-UHFFFAOYSA-M | | SMILES | COC([O-])=O.CCCC[N+](C)(CCCC)CCCC |
| Hazard Codes | T | | Risk Statements | 20/21/22-39/23/24/25 | | Safety Statements | 36/37-45 | | RIDADR | UN 1987 3/PG 3 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral
Flam. Liq. 3
STOT SE 1 |
| | Tributylmethylammonium methyl carbonate Usage And Synthesis |
| Uses | Tributylmethylammonium methyl carbonate can be used in the preparation of counter-cation anionic monomers by reacting with 2-acrylamido-2- methylpropanesulfonic acid and acrylic acid. |
| | Tributylmethylammonium methyl carbonate Preparation Products And Raw materials |
|