- Tributylmethylammonium bromide
-
- $6.00 / 6kg
-
2020-06-02
- CAS:37026-88-3
- Min. Order: 1kg
- Purity: High quality Professional Factory
- Supply Ability: Ms Ella chemwill_asia@126.com www.chemwill.com
|
| | Tributylmethylammonium bromide Basic information |
| Product Name: | Tributylmethylammonium bromide | | Synonyms: | n,n-dibutyl-n-methyl-1-butanaminiubromide;TRIBUTYLMETHYLAMMONIUM BROMIDE;METHYL TRI-N-BUTYLAMMONIUM BROMIDE;METHYLTRIBUTYLAMMONIUM BROMIDE;METHYLTRIALLYLAMMONIUM BROMIDE;Methyltri-n-butylammoniumbromide,98%;N-Methyl-N,N,N-tributylammonium bromide;Methyltributylaminium·bromide | | CAS: | 37026-88-3 | | MF: | C13H30BrN | | MW: | 280.29 | | EINECS: | 253-313-1 | | Product Categories: | | | Mol File: | 37026-88-3.mol |  |
| | Tributylmethylammonium bromide Chemical Properties |
| Melting point | 120-122°C | | solubility | H2O: 0.1 g/mL, clear, colorless | | form | crystals | | Water Solubility | H2O: 0.1g/mL, clear, colorless | | Sensitive | Hygroscopic | | BRN | 3704268 | | InChI | 1S/C13H30N.BrH/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;/h5-13H2,1-4H3;1H/q+1;/p-1 | | InChIKey | DHAWHVVWUNNONG-UHFFFAOYSA-M | | SMILES | [Br-].CCCC[N+](C)(CCCC)CCCC | | CAS DataBase Reference | 37026-88-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-9 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Tributylmethylammonium bromide Usage And Synthesis |
| | Tributylmethylammonium bromide Preparation Products And Raw materials |
|