| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-(4-Boc-piperazin-1-yl)-3-butenoic acid Basic information |
| | 2-(4-Boc-piperazin-1-yl)-3-butenoic acid Chemical Properties |
| Melting point | 157 °C (D) (lit.) | | Boiling point | 390.0±42.0 °C(Predicted) | | density | 1.154±0.06 g/cm3(Predicted) | | form | solid | | pka | 1.96±0.10(Predicted) | | InChI | 1S/C13H22N2O4/c1-5-10(11(16)17)14-6-8-15(9-7-14)12(18)19-13(2,3)4/h5,10H,1,6-9H2,2-4H3,(H,16,17) | | InChIKey | ZXJMXILXWUNTEW-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(C=C)C(O)=O |
| Hazard Codes | Xi,N | | Risk Statements | 41-50 | | Safety Statements | 26-36/37/39-60-61-39 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Dam. 1 |
| | 2-(4-Boc-piperazin-1-yl)-3-butenoic acid Usage And Synthesis |
| | 2-(4-Boc-piperazin-1-yl)-3-butenoic acid Preparation Products And Raw materials |
|