| Identification | Back Directory | [Name]
N-Boc-N-methyl-(S)-2-allylglycine | [CAS]
136092-76-7 | [Synonyms]
N-Boc-N-methyl-(S)-2-allylglycine (S)-2-((tert-Butoxycarbonyl)(methyl)amino)pent-4-enoic acid 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pent-4-enoic acid 4-Pentenoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]methylamino]-, (2S)- | [Molecular Formula]
C11H19NO4 | [MDL Number]
MFCD17214445 | [MOL File]
136092-76-7.mol | [Molecular Weight]
229.27 |
| Chemical Properties | Back Directory | [Boiling point ]
330.3±31.0 °C(Predicted) | [density ]
1.086±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C, stored under nitrogen | [pka]
3.85±0.10(Predicted) | [Appearance]
White to off-white Solid | [Optical Rotation]
Consistent with structure | [InChI]
InChI=1/C11H19NO4/c1-6-7-8(9(13)14)12(5)10(15)16-11(2,3)4/h6,8H,1,7H2,2-5H3,(H,13,14)/t8-/s3 | [InChIKey]
ZPXOGEHHZSOFJX-SBYBRXNCNA-N | [SMILES]
C(O)(=O)[C@@H](N(C(OC(C)(C)C)=O)C)CC=C |&1:3,r| |
|
| Company Name: |
Shanghai GL Peptide Ltd. Gold
|
| Tel: |
+86-21-61263340; 17609490614 13764994101 |
| Website: |
https://www.chemicalbook.com/supplier/10480342/ |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
https://www.chemicalbook.com/supplier/14555231/ |
|