Rhodamine B hydrazide
- CAS No.
- 74317-53-6
- Chemical Name:
- Rhodamine B hydrazide
- Synonyms
- RhodaMine B Cu2+ sensor;Rhodamine B hydrazide;2-AMINO-3',6'-BIS(DIETHYLAMINO)SPIRO[ISOINDOLE-1,9'-XANTHENE]-3-ONE;2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one;2-Amino-3',6'-bis(diethylamino)spiro[isoindoline-1,9'-xanthen]-3-one;Spiro[1H-isoindole-1,9'-[9H]xanthen]-3(2H)-one, 2-aMino-3',6'-bis(diethylaMino)-
- CBNumber:
- CB5375912
- Molecular Formula:
- C28H32N4O2
- Molecular Weight:
- 456.58
- MDL Number:
- MFCD07808762
- MOL File:
- 74317-53-6.mol
- MSDS File:
- SDS
- TDS File:
- TDS
| Melting point | 176-177 °C |
|---|---|
| Boiling point | 643.3±65.0 °C(Predicted) |
| Density | 1.27±0.1 g/cm3(Predicted) |
| solubility | DMF: 30 mg/ml; DMF:PBS(pH7.2) (1:2): 0.33 mg/ml; DMSO: 20 mg/ml; Ethanol: 0.1 mg/ml |
| form | A crystalline solid |
| pka | 6.44±0.20(Predicted) |
| color | Off-white to yellow |
| InChI | InChI=1S/C28H32N4O2/c1-5-30(6-2)19-13-15-23-25(17-19)34-26-18-20(31(7-3)8-4)14-16-24(26)28(23)22-12-10-9-11-21(22)27(33)32(28)29/h9-18H,5-8,29H2,1-4H3 |
| InChIKey | WTDHTIVYKKLOTC-UHFFFAOYSA-N |
| SMILES | C12(C3=C(C=C(N(CC)CC)C=C3)OC3=C1C=CC(N(CC)CC)=C3)C1=C(C=CC=C1)C(=O)N2N |
SAFETY
Risk and Safety Statements
| Symbol(GHS) |   GHS07,GHS05 |
|||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Signal word | Danger | |||||||||
| Hazard statements | H335-H318-H302-H315 | |||||||||
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P280-P305+P351+P338-P310-P264-P270-P301+P312-P330-P501 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-37/38-41 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 32049010 | |||||||||
| NFPA 704 |
|
Rhodamine B hydrazide price More Price(34)
| Manufacturer | Product number | Product description | CAS number | Packaging | Price | Updated | Buy |
|---|---|---|---|---|---|---|---|
| TCI Chemical | R0260 | Rhodamine B Hydrazide | 74317-53-6 | 200MG | $80 | 2026-04-30 | Buy |
| TCI Chemical | R0260 | Rhodamine B Hydrazide | 74317-53-6 | 1G | $240 | 2026-04-30 | Buy |
| Cayman Chemical | 23133 | Rhodamine B hydrazide ≥98% | 74317-53-6 | 5mg | $36 | 2026-04-30 | Buy |
| Cayman Chemical | 23133 | Rhodamine B hydrazide ≥98% | 74317-53-6 | 10mg | $63 | 2026-04-30 | Buy |
| Cayman Chemical | 23133 | Rhodamine B hydrazide ≥98% | 74317-53-6 | 25mg | $110 | 2026-04-30 | Buy |
Rhodamine B hydrazide Chemical Properties, Uses, Production
Uses
Rhodamine B hydrazide is a good probe for sulfite, with colorless and non-fluorescent properties. While the emission is related to the concentration of sulfite (5-800 ng/mL; detection limit=1.4 ng/mL (3σ)). Sulfite reduces dissolved oxygen to yield superoxide radicals, which binds to Rhodamine B hydrazide to form Rhodamine B. Rhodamine B hydrazide gives Rhodamine B-like fluorescence in the presence of sulfite, which is enhanced by Tween 80 surfactant micelles. Rhodamine B hydrazide has an absorption maximum at 554 nm and a fluorescence emission maximum at 574 nm[1].
References
[1] Yang X F, et al. Novel spectrofluorimetric method for the determination of sulfite with rhodamine B hydrazide in a micellar medium[J]. Analytica Chimica Acta, 2002, 456(1): 121-128.
Rhodamine B hydrazide Preparation Products And Raw materials
Raw materials
Preparation Products
Rhodamine B hydrazide Suppliers
| Supplier | Tel | Country | ProdList | Advantage | |
|---|---|---|---|---|---|
| Heliosense Biotechnologies,Inc | 0592-5667290 18649641090 | info@heliosense.com | China | 98 | 58 |
| Jinan Kewei Biotechnology Co., LTD | 15315592897 | xmxingbjlg@163.com | China | 201 | 58 |
| Changzhou Yinghao Technology Development Co., Ltd | 15151934985 | sales@yingsapharm.com | China | 5452 | 58 |
| Beijing HwrkChemical Technology Co., Ltd | 89508211 18501085097 | sales.bj@hwrkchemical.com | China | 9407 | 55 |
| Chengdu HappySyn Pharmaceutical Technology Co., Ltd. | 85114309 18982182443 | yangli@happysyn.com | China | 2297 | 55 |
| Hangzhou Sage Chemical Co., Ltd. | +86057186818502 13588463833 | info@sagechem.com | China | 10265 | 58 |
| Bide Pharmatech Ltd. | 400-164-7117 18317119277 | product02@bidepharm.com | China | 40000 | 60 |
| Shanghai ChuangYan Chemical Technology Co., Ltd. | 021-11111111 11111111111 | 546919421@qq.com | China | 3769 | 55 |
| Shanghai Xingui Biotechnology Co., Ltd. | 15121041756 | xingui2022@126.com | China | 9954 | 58 |
| Shanghai Macklin Biochemical Co.,Ltd. | 15221275939 15221275939 | shenlinxing@macklin.cn | China | 15775 | 55 |
