글루론산
|
|
글루론산 속성
- 물리적 상태
- Solid
- 색상
- White to off-white
- InChI
- InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3-,4+,5-/m0/s1
- InChIKey
- IAJILQKETJEXLJ-KLVWXMOXSA-N
- SMILES
- O=C[C@@H]([C@@H]([C@H]([C@@H](C(O)=O)O)O)O)O
안전
글루론산 C화학적 특성, 용도, 생산
개요
Glucuronic acid is a sugar acid derived from glucose, with its sixth carbon atom oxidized to a carboxylic acid. In living beings, this primary oxidation occurs with UDP-α-D-glucose (UDPG), not with the free sugar.Glucuronic acid, like its precursor glucose, can exist as a linear (carboxo-)aldohexose (<1%), or as a cyclic hemiacetal (furanose or pyranose). Aldohexoses such as D-glucose are capable of forming two furanose forms (α and β) and two pyranose forms (α and β). By the Fischer convention, glucuronic acid has two stereoisomers (enantiomers), D- and L-glucuronic acid, depending on its configuration at C-5. Most physiological sugars are of the D-configuration. Due to ring closure, cyclic sugars have another asymmetric carbon atom (C-1), resulting in two more stereoisomers, named anomers. Depending on the configuration at C-1, there are two anomers of glucuronic acid, α- and β-form. In β-D-glucuronic acid the C-1 hydroxy group is on the same side of the pyranose ring as the carboxyl group. In the free sugar acid, the β-form is prevalent (~64%), whereas in the organism, the α-form UDP-α-D-glucuronic acid (UDPGA) predominates.
글루론산 준비 용품 및 원자재
원자재
준비 용품
글루론산 공급 업체
글로벌( 40)공급 업체
| 공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
|---|---|---|---|---|---|
| Qingdio BZ Oligo Biotech Co., Ltd. | +0086-532-81926227 |
ann@marine-oligo.com | CHINA | 91 | 55 |
| Chengdu Biopurify Phytochemicals Ltd. | +86-28-82633860; +8618080483897 |
sales@biopurify.com | China | 3751 | 58 |
| HANGZHOU LEAP CHEM CO., LTD. | +86-571-87711850 |
market18@leapchem.com | China | 24727 | 58 |
| Henan Aochuang Chemical Co.,Ltd. | +86-0371-63689365 +8618638391208 |
sales@aochuangchem.com | China | 9297 | 58 |
| Wuhan Topule Biopharmaceutical Co., Ltd | +8618327326525 |
masar@topule.com | China | 8467 | 58 |
| Mensura Group Limited | 18780014153 |
1058503172@qq.com | China | 2900 | 58 |
| DAYANG CHEM (HANGZHOU) CO.,LTD | +86-88938639 +86-17705817739 |
info@dycnchem.com | China | 53899 | 58 |
| Amadis Chemical Company Limited | 571-89925085 |
sales@amadischem.com | China | 131957 | 58 |
| Chemwill Asia Co.,Ltd. | 86-21-51086038 |
chemwill_asia@126.com | CHINA | 23912 | 58 |
| Chengdu Biopurify Phytochemicals Ltd. | +86-028-82633397 18982077548 |
cwb1@biopurify.cn | China | 2376 | 60 |
글루론산 관련 검색:
만니노트리오스 당류B 글루쿠론산 2-케토-D-글루콘산 L-자일로-헥스-2-울로손산
L-decaguluronic acid decasodium salt
L-diguluronic acid disodium salt
L-heptaguluronic acid heptasodium salt
L-hexaguluronic acid hexasodium salt
D-pentamannuronic acid pentasodium salt
D-trimannuronic acid trisodium salt
D-heptamannuronic acid heptasodium salt
D-hexamannuronic acid hexasodium salt
D-octamannuronic acid octasodium salt
D-tetramannuronic acid tetrasodium salt
D-dimannuronic acid disodium salt
D-mannuronic acid sodium salt




