| Company Name: |
|
| Tel: |
|
| Email: |
info@glppharmastandards.com |
| Products Intro: |
Cas:1693-37-4
ProductName:Acetaminophen Impurity B/Acetaminophen Related Compound B
Purity: NLT 95% | Package: 25 MG 50 MG 100 MG 250 MG EXTRA
|
| Company Name: |
Guangzhou Austine Biotechnology Co., LTD
|
| Tel: |
15918640830 13268843209 |
| Email: |
1947181658@qq.com |
| Products Intro: |
Cas:1693-37-4
ProductName:ACETAMINOPHEN IMPURITY B
Purity: 95+% HPLC | Package: 50mg;100mg
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
sigmaname@qq.com |
| Products Intro: |
Cas:1693-37-4
ProductName:Acetaminophen Related Compound B
|
| Company Name: |
|
| Tel: |
|
| Email: |
mayur@clickchemresearch.com |
| Products Intro: |
Cas:1693-37-4
ProductName:Acetaminophen Related Compound B
Purity: 90 % Above | Package: 25 mg, 100 mg, 250 mg, 500 mg and 1.0 gm
|
| Company Name: |
Absin Bioscience Inc.
|
| Tel: |
021-38015121-8802 |
| Email: |
chenjw@absin.cn |
| Products Intro: |
Cas:1693-37-4
ProductName:ACETAMINOPHEN IMPURITY B
|
|
| | Acetaminophen Related Compound B Basic information |
| | Acetaminophen Related Compound B Chemical Properties |
| Melting point | 170-172°C | | Boiling point | 389.9±25.0 °C(Predicted) | | density | 1.201 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetonitrile (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.11±0.26(Predicted) | | color | White to Pale Purple | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C9H11NO2/c1-2-9(12)10-7-3-5-8(11)6-4-7/h3-6,11H,2H2,1H3,(H,10,12) | | InChIKey | SSMYTAQHMUHRSK-UHFFFAOYSA-N | | SMILES | C(NC1=CC=C(O)C=C1)(=O)CC | | CAS DataBase Reference | 1693-37-4 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Acetaminophen Related Compound B Usage And Synthesis |
| Uses | Acetaminophen Related Compound B is an impurity of the widely used antipyretic and analgesic drug acetaminophen, also known as paracetamol. |
| | Acetaminophen Related Compound B Preparation Products And Raw materials |
|