| Company Name: |
Shanghai Titan Scientific Co.,Ltd
|
| Tel: |
18616708014 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Cas:61-33-6
ProductName:Benzylpenicillin 1000 μg/mL in Acetonitrile:Water
Purity: 标准品 | Package: 1ml | CustNote: DRE-A10572880WL-1000
|
Related articles - Clinical Uses of Penicillin G
- Pen G remains a very effective treatment for infections caused by group A beta-hemolytic streptococci (which have not, to date....
- Mar 11，2022
|
| Product Name: | Benzylpenicillin Potassium | | Synonyms: | PENICILLIN G K-SALT;PENICILLIN G POTASSIUM;(5r,6r)-benzylpenicillin;(phenylmethyl)-penicilli;(phenylmethyl)penicillin;(phenylmethyl)-penicillinicaci;cilloral;cilopen | | CAS: | 61-33-6 | | MF: | C16H18N2O4S | | MW: | 334.39 | | EINECS: | 200-506-3 | | Product Categories: | | | Mol File: | 61-33-6.mol |  |
| | Benzylpenicillin Potassium Chemical Properties |
| Melting point | 82-83 °C | | Boiling point | 663.3±55.0 °C(Predicted) | | alpha | D +282° (ethanol) | | density | 1.2729 (rough estimate) | | refractive index | 1.6930 (estimate) | | storage temp. | 2-8°C | | solubility | H2O: 100 mg/mL | | form | powder | | pka | 2.45±0.50(Predicted) | | color | Crystals | | Water Solubility | 2.675g/L(25 ºC) | | InChI | InChI=1S/C16H18N2O4S/c1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22)/t11-,12+,14-/m1/s1 | | InChIKey | JGSARLDLIJGVTE-MBNYWOFBSA-N | | SMILES | N12[C@@]([H])([C@H](NC(CC3=CC=CC=C3)=O)C1=O)SC(C)(C)[C@@H]2C(O)=O | | CAS DataBase Reference | 61-33-6(CAS DataBase Reference) | | EPA Substance Registry System | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]- (2S,5R,6R)- (61-33-6) |
| | Benzylpenicillin Potassium Usage And Synthesis |
| Description | Benzylpenicillin potassium (Penicillin G potassium) is the potassium salt form of penicillin G, a broad-spectrum penicillin antibiotic. | | Indications | Benzylpenicillin Potassium is an antibacterial prescription medicine approved by the U.S. Food and Drug Administration (FDA) for the treatment of certain serious bacterial infections, such as pneumonia, meningitis, gonorrhea, syphilis, and others. | | Mechanism of action | Benzylpenicillin Potassium acts by inhibiting cell wall synthesis through binding to penicillin binding proteins (PBPs), inhibiting peptidoglycan chain cross-linking. |
| | Benzylpenicillin Potassium Preparation Products And Raw materials |
|