| Company Name: |
RYSS TECH LTD
|
| Tel: |
400-188-0725 021-34310725 13611771617 |
| Email: |
|
| Products Intro: |
Cas:515-42-4
ProductName:Sodium Benzenesulfonate
|
- Sodium benzenesulfonate
-
- $0.00 / 1KG
-
2020-02-26
- CAS: 515-42-4
- Min. Order: 1KG
- Purity: 99.0%+
- Supply Ability: 100 tons
|
| | Sodium Benzenesulfonate Basic information |
| | Sodium Benzenesulfonate Chemical Properties |
| Melting point | 450 °C | | density | 1.124 g/mL at 25 °C (lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | water: soluble | | form | Crystalline Powder | | color | White to off-white | | Water Solubility | soluble | | Sensitive | Hygroscopic | | Merck | 14,1070 | | BRN | 3918459 | | Stability: | Stable. Hygroscopic. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C6H6O3S.Na.H/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H,(H,7,8,9);; | | InChIKey | MZSDGDXXBZSFTG-UHFFFAOYSA-M | | SMILES | S(C1C=CC=CC=1)(O)(=O)=O.[NaH] | | CAS DataBase Reference | 515-42-4(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonic acid, sodium salt (515-42-4) |
| | Sodium Benzenesulfonate Usage And Synthesis |
| Physical properties | Sodium benzenesulfonate is a white, water-soluble solid.
| | Uses | Sodium benzenesulfonate has been used in Raman spectroscopic determination of molecular structural features in sulfonated polystyrene resins. It was used in the synthesis of 1-butyl-3-propanenitrile imidazolium benzenesulfonate.
| | Chemical Reactivity |
Heating sodium benzenesulfonate salt in strong base results in desulfonation, giving, after acid workup, phenol.This reaction was at one time, the principal route to phenol.
|
| | Sodium Benzenesulfonate Preparation Products And Raw materials |
|