| Company Name: |
Cayman Chemical Company
|
| Tel: |
800-364-9897 |
| Email: |
sales@caymanchem.com |
| Products Intro: |
Cas:301-00-8
ProductName:α-Linolenic Acid methyl ester
|
| Company Name: |
Hefei Bomei Biotechnology Co., Ltd.
|
| Tel: |
13739298932 13856598764 |
| Email: |
531626407@qq.com |
| Products Intro: |
Cas:301-00-8
ProductName:Methyl linolenate
Purity: Purity >=99%（GC） | Package: 100mg/350.00
|
|
| | Linolenic Acid Methyl Ester Basic information |
| Product Name: | Linolenic Acid Methyl Ester | | Synonyms: | 12,15-Octadecatrienoicacid,methylester,(Z,Z,Z)-9;15-octadecatrienoicacid,methylester,(z,z,z)-12;cis,cis,cis-octadeca-9,12,15-trienoicacidmethylester;Methyl (9Z,12Z,15Z)-9,12,15-octadecatrienoate;Methyl all-cis-9,12,15-octadecatrienoate;Methyl alpha-linolenate;Methyl linolenate, alpha;Methyl Linolenate (5 x 50 mg) | | CAS: | 301-00-8 | | MF: | C19H32O2 | | MW: | 292.46 | | EINECS: | 206-102-3 | | Product Categories: | Biochemistry;Higher Fatty Acids & Higher Alcohols;Unsaturated Higher Fatty Acid Esters;Analytical Chemistry;Fatty Acid Methyl Esters (GC Standard);Standard Materials for GC | | Mol File: | 301-00-8.mol |  |
| | Linolenic Acid Methyl Ester Chemical Properties |
| Melting point | -57℃ | | Boiling point | 182 °C/3 mmHg (lit.) | | density | 0.895 g/mL at 25 °C (lit.) | | FEMA | 3411 | METHYL LINOLEATE (48%) METHYL LINOLENATE (52%) MIXTURE | | refractive index | n20/D 1.470(lit.) | | Fp | 113 °C | | storage temp. | -20°C | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Liquid | | color | Clear colorless | | biological source | plant | | JECFA Number | 346 | | BRN | 1728194 | | Henry's Law Constant | 2.8×10-1 mol/(m3Pa) at 25℃, Krop and Velzen (1997) | | Stability: | Light Sensitive | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C19H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h4-5,7-8,10-11H,3,6,9,12-18H2,1-2H3/b5-4-,8-7-,11-10- | | InChIKey | DVWSXZIHSUZZKJ-YSTUJMKBSA-N | | SMILES | CC\C=C/C\C=C/C\C=C/CCCCCCCC(=O)OC | | LogP | 6.96 | | CAS DataBase Reference | 301-00-8(CAS DataBase Reference) | | EPA Substance Registry System | 9,12,15-Octadecatrienoic acid, methyl ester, (9Z,12Z,15Z)- (301-00-8) |
| Hazard Codes | Xn | | Risk Statements | 40-67-36/37/38 | | Safety Statements | 23-24/25-36/37-26 | | RIDADR | UN 1593 6.1/PG 3 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 29161500 | | Storage Class | 10 - Combustible liquids |
| | Linolenic Acid Methyl Ester Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Occurrence | Reported found in banana, grape, grapefruit juice, melon, strawberries, mushroom and cassava. | | Uses | Methyl Linolenate has potential application towards human lung carcinoma cell lines, displaying cytotoxicity. Essential oil component. | | Definition | ChEBI: Methyl linolenate is a fatty acid methyl ester derived from alpha-linolenic acid. It has a role as a plant metabolite and an insect attractant. It is functionally related to an alpha-linolenic acid. | | Chemical Reactivity | Methyl linolenate has two bis-allylic methylene groups and reacts twice as fast with oxygen as linoleate. Linoleate was 40 times more reactive than oleate, and linolenate was 2.4 times more reactive than linoleate. The two bis-allylic methylene groups in linolenate act independently and are not activated by each other. | | Biochem/physiol Actions | Methyl linolenate, a polyunsaturated fattly acid (PUFA), is used in studies on the mechanisms and prevention of oxidation/peroxidation of unsaturated fatty acids. Methyl linolenate is being studied as a possible skin whitening agent with anti-melanogenesis activity. |
| | Linolenic Acid Methyl Ester Preparation Products And Raw materials |
|