| Company Name: |
R&D Systems, Inc
|
| Tel: |
18003437475 |
| Email: |
rdname@qq.com |
| Products Intro: |
Cas:15826-37-6
ProductName:Sodium Cromoglicate
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Cas:15826-37-6
ProductName:Sodium cromoglicate for system suitability
|
| Company Name: |
Hubei wei shi reagent group ltd., company
|
| Tel: |
17771898297 13125137661 |
| Email: |
2853877621@qq.com |
| Products Intro: |
Cas:15826-37-6
ProductName:Sodium Cromoglicate
Package: 100G/RMB 1357;500G/RMB 6358;1000G/RMB 7258
|
| Company Name: |
HANGZHOU LOOP BIOTECH CO., LTD.
|
| Tel: |
057185260761 13396556070 |
| Email: |
sales@looppharm.com |
| Products Intro: |
Cas:15826-37-6
ProductName:Sodium Cromoglicate
Purity: 99.5%HPLC | Package: 8KG
|
|
| Product Name: | Sodium Cromoglicate | | Synonyms: | DSCG;disodium 5,5'-[(2-hydroxytrimethylene)dioxy]bis[4-oxo-4h-1-benzopyran-2-carboxylate];disodium 1,3-bis(2-carboxy-5-chromonyloxy)-2-propanol;CROMOGLYCATE SODIUM SALT;CROMOGLYCIC ACID SODIUM SALT;CROMOLYN SODIUM SALT;sodium 5-[3-[(2-carboxy-4-oxo-1-benzopyran-5-yl)oxy]-2-hydroxypropoxy]-4-oxo-1-benzopyran-2-carboxylic acid;4h-1-benzopyran-2-carboxylicacid,5,5’-((2-hydroxytrimethylene)dioxy)bis(4-oxo | | CAS: | 15826-37-6 | | MF: | C23H17NaO11 | | MW: | 492.37 | | EINECS: | 239-926-7 | | Product Categories: | INTAL;Other APIs;Intermediates & Fine Chemicals;Pharmaceuticals;Drug bulk;API | | Mol File: | 15826-37-6.mol |  |
| | Sodium Cromoglicate Chemical Properties |
| Melting point | 241-2420C (dec) | | storage temp. | 2-8°C | | solubility | Soluble in water, practically insoluble in ethanol (96 per cent). | | form | Solid | | color | White to Off-White | | Water Solubility | Soluble in water to 100mg/ml | | Merck | 14,2590 | | Stability: | Hygroscopyc | | Cosmetics Ingredients Functions | ANTI-SEBUM | | InChIKey | VLARUOGDXDTHEH-UHFFFAOYSA-L | | SMILES | O(C1C=CC=C2OC(C(=O)O)=CC(=O)C=12)CC(O)COC1C=CC=C2OC(C(=O)O)=CC(=O)C=12.[NaH] | | CAS DataBase Reference | 15826-37-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3249 | | WGK Germany | 2 | | RTECS | DJ2380000 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 | | Toxicity | LD50 in mice, rats (mg/kg): >8000 orally (Cox) |
| | Sodium Cromoglicate Usage And Synthesis |
| Uses |
Sodium Cromoglicate is an eye drop used to treat allergic conjunctivitis (hay fever) by reducing the redness, itch, watering and irritation of the eyes associated with the condition.
| | Pharmaceutical Applications | Sodium Cromoglicate is a promotes transformation ESCs/iPSCs into pancreatic endocrine islet cells. Facilitates differentiation from endocrine precursors. Also inhibits mast cell degranulation and histamine release. | | Side effects | Temporary stinging or burning may occur after using the drops. | | Physiological effects | Sodium Cromoglicate works by stabilising the mast cells that release histamine.
|
| | Sodium Cromoglicate Preparation Products And Raw materials |
|