| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Hexaphenylcyclotrisiloxane Basic information |
| Product Name: | Hexaphenylcyclotrisiloxane | | Synonyms: | 2,2,4,4,6,6-Hexaphenyl-[1,3,5,2,4,6]trioxatrisilinan;2,2,4,4,6,6-Hexaphenyl-1,3,5,2,4,6-trioxatrisilinane;Cyclotrisiloxane, hexaphenyl-;Diphenylsiloxane cyclic trimer;Cyclotrisiloxane,2,2,4,4,6,6-hexaphenyl-;hexaphenyl-cyclotrisiloxan;Hexaphenylcyclotrisiloxane, 98+%;HEXAPHENYLCYCLOTRISILOXANE | | CAS: | 512-63-0 | | MF: | C36H30O3Si3 | | MW: | 594.88 | | EINECS: | 208-145-3 | | Product Categories: | Chemical Synthesis;Organometallic Reagents;Si (Classes of Silicon Compounds);Siloxanes;Si-O Compounds;Organometallic Reagents;Organosilicon | | Mol File: | 512-63-0.mol |  |
| | Hexaphenylcyclotrisiloxane Chemical Properties |
| Melting point | 184-188 °C (lit.) | | Boiling point | 300 °C/1 mmHg (lit.) | | density | 1.23 | | Fp | 300°C/1mm | | Water Solubility | Insoluble in water | | solubility | Benzene (Slightly), Chloroform (Sparingly) | | form | solid | | Specific Gravity | 1.23 | | color | White to Almost white | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | Sensitive | Moisture Sensitive | | BRN | 2957773 | | InChI | 1S/C36H30O3Si3/c1-7-19-31(20-8-1)40(32-21-9-2-10-22-32)37-41(33-23-11-3-12-24-33,34-25-13-4-14-26-34)39-42(38-40,35-27-15-5-16-28-35)36-29-17-6-18-30-36/h1-30H | | InChIKey | VCYDUTCMKSROID-UHFFFAOYSA-N | | SMILES | O1[Si](O[Si](O[Si]1(c2ccccc2)c3ccccc3)(c4ccccc4)c5ccccc5)(c6ccccc6)c7ccccc7 | | CAS DataBase Reference | 512-63-0(CAS DataBase Reference) | | NIST Chemistry Reference | Hexaphenylcyclotrisiloxane(512-63-0) | | EPA Substance Registry System | Cyclotrisiloxane, hexaphenyl- (512-63-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Hexaphenylcyclotrisiloxane Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 2,2,4,4,6,6-hexakis-phenyl-1,3,5,2,4,6-trioxatrisilinane is a henylsilsesquioxane with high thermal stability, used as a cross-coupling reagent used in palladium-catalyzed cross-coupling reactions with aryl halides. |
| | Hexaphenylcyclotrisiloxane Preparation Products And Raw materials |
|