|
|
| | Ginkgolic acid (13:0) Basic information |
| Product Name: | Ginkgolic acid (13:0) | | Synonyms: | 6-n-tridecylsalicylic acid;6-Tridecylsalicylic acid;Ginkgoneolic acid;Ginkgolic Acids
(C13:0);Ginkgoneolic acid
6-Tridecylsalicylic acid;GA13:0;Ginkgolic Acid 13:0 〔Anacardic Acid 13:0〕;Ginkgoneolic acid, 98%, from Ginkgo biloba L. | | CAS: | 20261-38-5 | | MF: | C20H32O3 | | MW: | 320.47 | | EINECS: | | | Product Categories: | | | Mol File: | 20261-38-5.mol |  |
| | Ginkgolic acid (13:0) Chemical Properties |
| Boiling point | 449.5±33.0 °C(Predicted) | | density | 1.018±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | solubility | Soluble in methan | | form | Solid | | pka | 3.08±0.30(Predicted) | | color | White | | InChI | InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-17-15-13-16-18(21)19(17)20(22)23/h13,15-16,21H,2-12,14H2,1H3,(H,22,23) | | InChIKey | VEPUCZUJLKAVNM-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(CCCCCCCCCCCCC)C=CC=C1O | | LogP | 8.900 (est) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 29163990 |
| | Ginkgolic acid (13:0) Usage And Synthesis |
| Chemical Properties | Derived from Ginkgo biloba | | Uses | Ginkgoneolic Acid is a natural mutagenic, carcinogenic and genotoxic agent. An isolate from Ginkgo Biloba leaf, used in traditional medicines treating inflammation and cell proliferation. | | Definition | ChEBI: 2-Hydroxy-6-tridecylbenzoic acid is a hydroxybenzoic acid. It is functionally related to a salicylic acid. | | target | Antifection | α-glucosidase |
| | Ginkgolic acid (13:0) Preparation Products And Raw materials |
|