8-Oxa-3-azabicyclo[3.2.1]octanehydrochloride manufacturers
|
| | 8-Oxa-3-azabicyclo[3.2.1]octanehydrochloride Basic information |
| | 8-Oxa-3-azabicyclo[3.2.1]octanehydrochloride Chemical Properties |
| Melting point | 197-199 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | Appearance | White to light brown Solid | | InChI | InChI=1/C6H11NO.ClH/c1-2-6-4-7-3-5(1)8-6;/h5-7H,1-4H2;1H/t5-,6+; | | InChIKey | XADOTNAXKKFKDY-KNCHESJLNA-N | | SMILES | [C@@]12([H])O[C@@]([H])(CC1)CNC2.Cl |&1:0,3,r| | | CAS DataBase Reference | 54745-74-3 |
| WGK Germany | WGK 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | 8-Oxa-3-azabicyclo[3.2.1]octanehydrochloride Usage And Synthesis |
| Uses | 8-Oxa-3-azabicyclo[3.2.1]octane hydrochloride is employed as a important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field. |
| | 8-Oxa-3-azabicyclo[3.2.1]octanehydrochloride Preparation Products And Raw materials |
|